Gaillardin
Internal ID | cc74aed6-fe0d-4adc-ae77-fc970ac144c2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
IUPAC Name | [(3aS,5aS,6S,8R,8aR,9aR)-8-hydroxy-5,8-dimethyl-1-methylidene-2-oxo-5a,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-6-yl] acetate |
SMILES (Canonical) | CC1=CC2C(CC3C1C(CC3(C)O)OC(=O)C)C(=C)C(=O)O2 |
SMILES (Isomeric) | CC1=C[C@H]2[C@H](C[C@@H]3[C@@H]1[C@H](C[C@@]3(C)O)OC(=O)C)C(=C)C(=O)O2 |
InChI | InChI=1S/C17H22O5/c1-8-5-13-11(9(2)16(19)22-13)6-12-15(8)14(21-10(3)18)7-17(12,4)20/h5,11-15,20H,2,6-7H2,1,3-4H3/t11-,12-,13+,14+,15-,17-/m1/s1 |
InChI Key | UTPGJEROJZHISI-DFGCRIRUSA-N |
Popularity | 8 references in papers |
Molecular Formula | C17H22O5 |
Molecular Weight | 306.40 g/mol |
Exact Mass | 306.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 1.20 |
14682-46-3 |
CHEBI:5240 |
NSC 106394 |
CHEMBL490386 |
DTXSID70295941 |
NSC106394 |
NSC-106394 |
[(3aS,5aS,6S,8R,8aR,9aR)-8-hydroxy-5,8-dimethyl-1-methylidene-2-oxo-5a,6,7,8a,9,9a-hexahydro-3aH-azuleno[6,5-b]furan-6-yl] acetate |
C09455 |
Q27106695 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.51% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.84% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.59% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.97% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.93% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.66% | 86.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.01% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.56% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.55% | 99.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.88% | 90.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.62% | 85.14% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.00% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.89% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.00% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.48% | 91.19% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.79% | 95.38% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.10% | 85.30% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.02% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asteraceae |
Gaillardia pulchella |
Pentanema montanum |
Pulicaria paludosa |
PubChem | 267247 |
NPASS | NPC213078 |
ChEMBL | CHEMBL490386 |
LOTUS | LTS0170269 |
wikiData | Q27106695 |