Fusidienol A
| Internal ID | fdfd0000-c5a2-4c51-adf4-b622735109d5 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | methyl 7-hydroxy-9-methyl-6-oxooxepino[2,3-b]chromene-5-carboxylate |
| SMILES (Canonical) | CC1=CC(=C2C(=C1)OC3=C(C2=O)C(=CC=CO3)C(=O)OC)O |
| SMILES (Isomeric) | CC1=CC(=C2C(=C1)OC3=C(C2=O)C(=CC=CO3)C(=O)OC)O |
| InChI | InChI=1S/C16H12O6/c1-8-6-10(17)13-11(7-8)22-16-12(14(13)18)9(15(19)20-2)4-3-5-21-16/h3-7,17H,1-2H3 |
| InChI Key | SEBVTYCKKTZQMP-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 82.10 Ų |
| XlogP | 2.80 |
| Fusidienol A |
| SCHEMBL8815362 |
| BDBM50518786 |
| NSC793372 |
| NSC-793372 |
| 187805-52-3 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.46% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.50% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.71% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.75% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.44% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.36% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.05% | 95.56% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.96% | 93.65% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.53% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.35% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.22% | 85.14% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.42% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.15% | 86.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.78% | 96.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.31% | 91.19% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.85% | 94.80% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.37% | 89.63% |
| CHEMBL3194 | P02766 | Transthyretin | 80.89% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 9882772 |
| LOTUS | LTS0201671 |
| wikiData | Q104197208 |