Fuscoatramide
| Internal ID | abdeb38f-30a8-4b40-a43f-30a177f3f395 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Amino acids and derivatives > Gamma amino acids and derivatives |
| IUPAC Name | 4-[[(Z)-5-hydroxy-3-methylpent-2-enoyl]amino]butanoic acid |
| SMILES (Canonical) | CC(=CC(=O)NCCCC(=O)O)CCO |
| SMILES (Isomeric) | C/C(=C/C(=O)NCCCC(=O)O)/CCO |
| InChI | InChI=1S/C10H17NO4/c1-8(4-6-12)7-9(13)11-5-2-3-10(14)15/h7,12H,2-6H2,1H3,(H,11,13)(H,14,15)/b8-7- |
| InChI Key | CPVSDCNZYNEHTP-FPLPWBNLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.11575802 g/mol |
| Topological Polar Surface Area (TPSA) | 86.60 Ų |
| XlogP | 0.10 |
| 4-[[(Z)-5-hydroxy-3-methylpent-2-enoyl]amino]butanoic acid |
| 476485-50-4 |
| 4-(((Z)-5-hydroxy-3-methylpent-2-enoyl)amino)butanoic acid |
| RefChem:141963 |
| CHEBI:202704 |
| (Z)-4-(5-Hydroxy-3-methylpent-2-enamido)butanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.11% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.35% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.91% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.75% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.51% | 91.11% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.35% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10976838 |
| LOTUS | LTS0208754 |
| wikiData | Q77373025 |