Fusariumin
Internal ID | 48b5e068-d243-4718-9588-ac8cba133cfc |
Taxonomy | Phenylpropanoids and polyketides > Isocoumarins and derivatives |
IUPAC Name | 6,8-dihydroxy-3-[(E,8S)-8-hydroxynon-5-enyl]isochromen-1-one |
SMILES (Canonical) | CC(CC=CCCCCC1=CC2=CC(=CC(=C2C(=O)O1)O)O)O |
SMILES (Isomeric) | C[C@@H](C/C=C/CCCCC1=CC2=CC(=CC(=C2C(=O)O1)O)O)O |
InChI | InChI=1S/C18H22O5/c1-12(19)7-5-3-2-4-6-8-15-10-13-9-14(20)11-16(21)17(13)18(22)23-15/h3,5,9-12,19-21H,2,4,6-8H2,1H3/b5-3+/t12-/m0/s1 |
InChI Key | MIICTKRWRNNLEI-PYEVWLCESA-N |
Popularity | 8 references in papers |
Molecular Formula | C18H22O5 |
Molecular Weight | 318.40 g/mol |
Exact Mass | 318.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 3.90 |
CHEMBL1684400 |
![2D Structure of Fusariumin 2D Structure of Fusariumin](https://plantaedb.com/storage/docs/compounds/2023/11/fusariumin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.60% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.04% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.12% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.78% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.32% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.08% | 94.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.23% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.28% | 95.56% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.24% | 96.12% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.71% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.23% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.28% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.73% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.46% | 90.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.45% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melia azedarach |
PubChem | 53322161 |
LOTUS | LTS0142297 |
wikiData | Q77519501 |