Fusarin
| Internal ID | d0ae76a2-b6ae-4f36-9d2e-6e3b4d82f193 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1R,4S,5R)-4-hydroxy-4-(2-hydroxyethyl)-1-[(2E,4E,6E,8E,10Z)-2,6,8,10-tetramethyldodeca-2,4,6,8,10-pentaenoyl]-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES (Canonical) | CC=C(C)C=C(C)C=C(C)C=CC=C(C)C(=O)C12C(O1)C(NC2=O)(CCO)O |
| SMILES (Isomeric) | C/C=C(/C)\C=C(/C)\C=C(/C)\C=C\C=C(/C)\C(=O)[C@@]12[C@@H](O1)[C@](NC2=O)(CCO)O |
| InChI | InChI=1S/C22H29NO5/c1-6-14(2)12-16(4)13-15(3)8-7-9-17(5)18(25)22-19(28-22)21(27,10-11-24)23-20(22)26/h6-9,12-13,19,24,27H,10-11H2,1-5H3,(H,23,26)/b8-7+,14-6-,15-13+,16-12+,17-9+/t19-,21-,22-/m0/s1 |
| InChI Key | RCJADKVBRBVIEX-YAMKEULKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.20457303 g/mol |
| Topological Polar Surface Area (TPSA) | 99.20 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.96% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.26% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.00% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.45% | 97.09% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.75% | 97.28% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 86.70% | 80.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.53% | 89.34% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.28% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.27% | 95.56% |
| CHEMBL2061 | P19793 | Retinoid X receptor alpha | 83.30% | 91.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.73% | 98.95% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.48% | 92.88% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.49% | 88.56% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.16% | 91.24% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.00% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15942871 |
| LOTUS | LTS0085937 |
| wikiData | Q105233704 |