Fruticulin A
| Internal ID | af9ea198-84fc-4316-b768-65cd18d7ccd6 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 7-hydroxy-14-methoxy-12-methyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(11),2,6,8,12,14-hexaene-4,5-dione |
| SMILES (Canonical) | CC1=CC(=CC2=C1CC=C3C(=C2)C(=O)C(=O)C(=C3O)C(C)C)OC |
| SMILES (Isomeric) | CC1=CC(=CC2=C1CC=C3C(=C2)C(=O)C(=O)C(=C3O)C(C)C)OC |
| InChI | InChI=1S/C20H20O4/c1-10(2)17-18(21)15-6-5-14-11(3)7-13(24-4)8-12(14)9-16(15)19(22)20(17)23/h6-10,21H,5H2,1-4H3 |
| InChI Key | NZMUXZBQDVLKSD-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 3.20 |
| 106664-40-8 |
| FYS7RQN2Q8 |
| UNII-FYS7RQN2Q8 |
| NSC625555 |
| NSC 625555 |
| 3-Hydroxy-2-isopropyl-7-methoxy-9-methyl-1H-dibenzo(a,d)cycloheptene-1,4(10H)-dione |
| NSC-625555 |
| Fruticuline A |
| 3-Hydroxy-2-isopropyl-7-methoxy-9-methyl-1H-dibenzo[a,d]cycloheptene-1,4(10H)-dione |
| DTXSID80910072 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.88% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.14% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.34% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.23% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.86% | 93.40% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.52% | 98.75% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.26% | 96.77% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.79% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.19% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.62% | 90.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.36% | 91.07% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.84% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.12% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.93% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.04% | 96.09% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.54% | 93.65% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.47% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Salvia corrugata |
| Salvia fruticulosa |
| PubChem | 362046 |
| LOTUS | LTS0121477 |
| wikiData | Q105188313 |