Fredericamycin A
| Internal ID | 6732e222-c376-454d-a0a7-3620c7080dbc |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives |
| IUPAC Name | (8S)-1',3',9-trihydroxy-6'-methoxy-3-[(1E,3E)-penta-1,3-dienyl]spiro[6,7-dihydro-2H-cyclopenta[g]isoquinoline-8,2'-cyclopenta[b]naphthalene]-1,4',5',8',9'-pentone |
| SMILES (Canonical) | CC=CC=CC1=CC2=CC3=C(C(=C2C(=O)N1)O)C4(CC3)C(=C5C(=C4O)C(=O)C6=C(C5=O)C(=O)C=C(C6=O)OC)O |
| SMILES (Isomeric) | C/C=C/C=C/C1=CC2=CC3=C(C(=C2C(=O)N1)O)[C@@]4(CC3)C(=C5C(=C4O)C(=O)C6=C(C5=O)C(=O)C=C(C6=O)OC)O |
| InChI | InChI=1S/C30H21NO9/c1-3-4-5-6-14-10-13-9-12-7-8-30(22(12)26(36)17(13)29(39)31-14)27(37)20-21(28(30)38)25(35)19-18(24(20)34)15(32)11-16(40-2)23(19)33/h3-6,9-11,36-38H,7-8H2,1-2H3,(H,31,39)/b4-3+,6-5+/t30-/m0/s1 |
| InChI Key | NJLAGDPRCAPJIF-MHSJTTIKSA-N |
| Popularity | 32 references in papers |
| Molecular Formula | C30H21NO9 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.12163125 g/mol |
| Topological Polar Surface Area (TPSA) | 167.00 Ų |
| XlogP | 3.90 |
| Fcrc-A48 |
| FDM A |
| WSY58QC629 |
| NSC-305263 |
| 80455-68-1 |
| UNII-WSY58QC629 |
| FREDERICAMYCIN A [MI] |
| CHEMBL256952 |
| orb3024816 |
| SCHEMBL2137782 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 99.47% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.76% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.79% | 93.99% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.50% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.88% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.72% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.48% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.31% | 92.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.13% | 94.45% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 92.48% | 91.03% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.39% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.33% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.68% | 99.23% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.52% | 92.98% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 85.81% | 91.79% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.89% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.73% | 89.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.75% | 95.56% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 83.31% | 98.00% |
| CHEMBL290 | Q13370 | Phosphodiesterase 3B | 82.99% | 94.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.89% | 89.63% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.93% | 91.07% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.56% | 95.50% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.38% | 94.42% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.17% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 135427349 |
| LOTUS | LTS0230487 |
| wikiData | Q77571947 |