Fortunellin
Internal ID | 1ef2be30-70bc-4b71-8622-e4ec4fdd5809 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)CO)O)O)O)O)O |
InChI | InChI=1S/C28H32O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-14-7-15(30)20-16(31)9-17(40-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-9,11,19,21-30,32-36H,10H2,1-2H3/t11-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1 |
InChI Key | MLWDGPFGTFOLRJ-CUVHLRMHSA-N |
Popularity | 6 references in papers |
Molecular Formula | C28H32O14 |
Molecular Weight | 592.50 g/mol |
Exact Mass | 592.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 0.10 |
20633-93-6 |
Acacetin-7-O-neohesperidoside |
SCHEMBL4649125 |
DTXSID00861996 |
MLWDGPFGTFOLRJ-CUVHLRMHSA-N |
MFCD00063944 |
AKOS040761748 |
FS-6820 |
Q63409698 |
4H-1-Benzopyran-4-one, 7-[[2-O-(6-deoxy-.alpha.-L-mannopyranosyl)-.beta.-D-glucopyranosyl]oxy]-5-hydroxy-2-(4-methoxyphenyl)- |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.70% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.62% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.66% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.13% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 96.01% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.15% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.88% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 93.55% | 86.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.50% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.29% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.40% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.15% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.94% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.92% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.65% | 99.17% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.43% | 93.31% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.26% | 81.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.87% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.61% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 83.60% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.15% | 96.21% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.96% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.21% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus japonica |
Clinopodium acinos |
Lycopus europaeus |
Trollius ledebourii |
PubChem | 5317385 |
LOTUS | LTS0180376 |
wikiData | Q63409698 |