Forskoditerpenoside D
Internal ID | 9bec2f3d-2106-454c-8768-769ca9b19398 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(3R,4aS,5S,6S,6aS,10S,10aS,10bR)-5-acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-1-oxo-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-6-yl] acetate |
SMILES (Canonical) | CC(=O)OC1C2C(CCC(C2(C3C(=O)CC(OC3(C1OC(=O)C)C)(C)C=C)C)OC4C(C(C(C(O4)CO)O)O)O)(C)C |
SMILES (Isomeric) | CC(=O)O[C@H]1[C@@H]2[C@]([C@H](CCC2(C)C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)([C@H]4C(=O)C[C@](O[C@@]4([C@H]1OC(=O)C)C)(C)C=C)C |
InChI | InChI=1S/C30H46O12/c1-9-28(6)12-16(34)23-29(7)18(41-26-21(37)20(36)19(35)17(13-31)40-26)10-11-27(4,5)24(29)22(38-14(2)32)25(39-15(3)33)30(23,8)42-28/h9,17-26,31,35-37H,1,10-13H2,2-8H3/t17-,18+,19-,20+,21-,22+,23-,24+,25+,26+,28+,29-,30+/m1/s1 |
InChI Key | VTUVSVLCBDCVJA-ZRHKENGMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H46O12 |
Molecular Weight | 598.70 g/mol |
Exact Mass | 598.29892690 g/mol |
Topological Polar Surface Area (TPSA) | 178.00 Ų |
XlogP | 0.70 |
6beta,7beta-diacetoxy-8,13-epoxy-labd-14-en-11-one-1alpha-O-beta-D-glucopyranoside |
(3R,4aS,5S,6S,6aS,10S,10aS,10bR)-10-(beta-D-glucopyranosyloxy)-3,4a,7,7,10a-pentamethyl-1-oxo-3-vinyldodecahydro-1H-benzo[f]chromene-5,6-diyl diacetate |
CHEBI:65908 |
DTXSID801100067 |
Q27134403 |
(3R,4aS,5S,6S,6aS,10S,10aS,10bR)-5,6-Bis(acetyloxy)-3-ethenyl-10-(beta-D-glucopyranosyloxy)dodecahydro-3,4a,7,7,10a-pentamethyl-1H-naphtho[2,1-b]pyran-1-one |
[(3R,4aS,5S,6S,6aS,10S,10aS,10bR)-5-acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-1-oxo-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-6-yl] acetate |
1041183-13-4 |
![2D Structure of Forskoditerpenoside D 2D Structure of Forskoditerpenoside D](https://plantaedb.com/storage/docs/compounds/2023/11/forskoditerpenoside-d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.70% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.97% | 97.25% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 92.91% | 91.24% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 92.17% | 82.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.25% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 89.61% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.39% | 96.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.22% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.22% | 86.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.99% | 93.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.60% | 92.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.74% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.74% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.51% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.70% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.11% | 91.07% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.94% | 91.19% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.98% | 93.04% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.77% | 92.62% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.39% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Plectranthus barbatus |
PubChem | 24795561 |
LOTUS | LTS0205083 |
wikiData | Q27134403 |