Fomecin A
| Internal ID | 15975221-7f5e-4429-985f-8bc52b295d1d |
| Taxonomy | Benzenoids > Phenols > Benzenetriols and derivatives > Pyrogallols and derivatives |
| IUPAC Name | 2,3,4-trihydroxy-6-(hydroxymethyl)benzaldehyde |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C8H8O5/c9-2-4-1-6(11)8(13)7(12)5(4)3-10/h1,3,9,11-13H,2H2 |
| InChI Key | MGMUFSXXHCQPGA-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.03717335 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 0.00 |
| 2,3,4-Trihydroxy-6-(hydroxymethyl)benzaldehyde |
| Fomecin |
| 1403-56-1 |
| Benzaldehyde, 2,3,4-trihydroxy-6-(hydroxymethyl)- |
| 1E2L0W6KK8 |
| NSC-73231 |
| FOMECIN-A |
| NSC 73231 |
| BRN 2693556 |
| UNII-1E2L0W6KK8 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 98.57% | 98.11% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.81% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.18% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.85% | 94.73% |
| CHEMBL3194 | P02766 | Transthyretin | 86.06% | 90.71% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.85% | 91.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.25% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.04% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14964 |
| LOTUS | LTS0120865 |
| wikiData | Q83029670 |