Florosenine (neutral)
Internal ID | 8457943a-4f87-40b0-9a53-a80e8cd85548 |
Taxonomy | Organoheterocyclic compounds > Azaspirodecane derivatives |
IUPAC Name | [(1R,3'S,6R,7R,11Z)-3',6,7,14-tetramethyl-3,8,17-trioxospiro[2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-4,2'-oxirane]-7-yl] acetate |
SMILES (Canonical) | CC1CC2(C(O2)C)C(=O)OC3CCN(CC=C(C3=O)COC(=O)C1(C)OC(=O)C)C |
SMILES (Isomeric) | C[C@@H]1CC2([C@@H](O2)C)C(=O)O[C@@H]3CCN(C/C=C(\C3=O)/COC(=O)[C@]1(C)OC(=O)C)C |
InChI | InChI=1S/C21H29NO8/c1-12-10-21(13(2)29-21)19(26)28-16-7-9-22(5)8-6-15(17(16)24)11-27-18(25)20(12,4)30-14(3)23/h6,12-13,16H,7-11H2,1-5H3/b15-6-/t12-,13+,16-,20-,21?/m1/s1 |
InChI Key | RNNVXCSFOWGBQP-XHLNSLBNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H29NO8 |
Molecular Weight | 423.50 g/mol |
Exact Mass | 423.18931688 g/mol |
Topological Polar Surface Area (TPSA) | 112.00 Ų |
XlogP | 1.20 |
Otosenine 12-acetate |
[(1R,3'S,6R,7R,11Z)-3',6,7,14-tetramethyl-3,8,17-trioxospiro[2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-4,2'-oxirane]-7-yl] acetate |
Florosenine (neutral) |
4,8-Secosenecionan-8,11,16-trione, 15,20-dihydro-12-(acetyloxy)-15,20-epoxy-4-methyl-, (15-alpha,20S) |
![2D Structure of Florosenine (neutral) 2D Structure of Florosenine (neutral)](https://plantaedb.com/storage/docs/compounds/2023/11/florosenine-neutral.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.00% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.61% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.24% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 89.21% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.47% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.42% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.10% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.04% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.54% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.09% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.05% | 92.94% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.49% | 94.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.47% | 96.77% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.92% | 96.43% |
CHEMBL5028 | O14672 | ADAM10 | 82.64% | 97.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.89% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.38% | 97.14% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.27% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jacobaea adonidifolia |
Packera aurea |
Packera glabella |
Senecio flaccidus var. douglasii |
Senecio inaequidens |
Senecio leptolobus |
PubChem | 6441404 |
LOTUS | LTS0131516 |
wikiData | Q105241643 |