Floribundal
Internal ID | a8125d07-a0a8-4855-9725-e57d451e0b9e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Iridoids and derivatives |
IUPAC Name | methyl (1R,4aS,6S,7R,7aS)-6-[(2S,3S,4S)-3-formyl-4-(2-methoxy-2-oxoethyl)-2-methyl-3,4-dihydro-2H-pyran-5-carbonyl]oxy-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1C(CC2C1C(OC=C2C(=O)OC)O)OC(=O)C3=COC(C(C3CC(=O)OC)C=O)C |
SMILES (Isomeric) | C[C@H]1[C@H](C[C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O)OC(=O)C3=CO[C@H]([C@H]([C@@H]3CC(=O)OC)C=O)C |
InChI | InChI=1S/C22H28O10/c1-10-17(5-13-16(20(25)29-4)9-31-22(27)19(10)13)32-21(26)15-8-30-11(2)14(7-23)12(15)6-18(24)28-3/h7-14,17,19,22,27H,5-6H2,1-4H3/t10-,11-,12-,13+,14+,17-,19+,22+/m0/s1 |
InChI Key | OGVKQJQFXCWBTO-ZNIMCIPQSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C22H28O10 |
Molecular Weight | 452.50 g/mol |
Exact Mass | 452.16824709 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | 0.60 |
CHEMBL463607 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.38% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.33% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.44% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.14% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.65% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.60% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.31% | 99.17% |
CHEMBL5028 | O14672 | ADAM10 | 83.08% | 97.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.46% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.91% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.65% | 91.19% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.48% | 97.21% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.12% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scaevola floribunda |
PubChem | 10575614 |
LOTUS | LTS0053458 |
wikiData | Q105191891 |