Filicenol B
Internal ID | 5e687b4e-5d78-464a-a199-2df92a984f20 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(3R,3aR,5aR,5bR,7aS,11aR,11bR,13aS,13bR)-3a,5a,7a,8,13a-pentamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,10,11,11a,12,13,13b-tetradecahydrocyclopenta[a]chrysen-11b-yl]methanol |
SMILES (Canonical) | CC1=CCCC2C1(CCC3C2(CCC4(C3(CCC5(C4CCC5C(C)C)C)C)C)CO)C |
SMILES (Isomeric) | CC1=CCC[C@@H]2[C@@]1(CC[C@H]3[C@]2(CC[C@@]4([C@@]3(CC[C@]5([C@H]4CC[C@@H]5C(C)C)C)C)C)CO)C |
InChI | InChI=1S/C30H50O/c1-20(2)22-11-12-23-27(22,5)15-16-29(7)25-13-14-26(4)21(3)9-8-10-24(26)30(25,19-31)18-17-28(23,29)6/h9,20,22-25,31H,8,10-19H2,1-7H3/t22-,23-,24-,25-,26-,27-,28+,29-,30-/m1/s1 |
InChI Key | BBMOJJIXVZRNCE-PVJFAIIUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H50O |
Molecular Weight | 426.70 g/mol |
Exact Mass | 426.386166214 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 9.20 |
145103-37-3 |
[(3R,3aR,5aR,5bR,7aS,11aR,11bR,13aS,13bR)-3a,5a,7a,8,13a-pentamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,10,11,11a,12,13,13b-tetradecahydrocyclopenta[a]chrysen-11b-yl]methanol |
HY-N9087 |
CS-0158675 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.52% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.99% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.40% | 94.45% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.19% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.02% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.00% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.26% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 87.92% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.90% | 95.89% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.89% | 90.24% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.92% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.86% | 82.69% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.58% | 92.88% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.17% | 96.61% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.85% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.32% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.86% | 94.75% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.42% | 90.17% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.27% | 93.00% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 81.56% | 87.16% |
CHEMBL4072 | P07858 | Cathepsin B | 80.48% | 93.67% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.09% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adiantum monochlamys |
PubChem | 101114249 |
LOTUS | LTS0070290 |
wikiData | Q104922859 |