[(1S,2R,3R,4R,5S,6S,8R,9R,10R,13R,14R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 3,4-dimethoxybenzoate
| Internal ID | ef63f486-6342-4b88-bad0-2b11b8fcedae |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
| IUPAC Name | [(1S,2R,3R,4R,5S,6S,8R,9R,10R,13R,14R,16S,17S,18R)-11-ethyl-5,8,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 3,4-dimethoxybenzoate |
| SMILES (Canonical) | CCN1CC2(C(CC(C34C2C(C(C31)C5(CC(C6(CC4C5C6OC(=O)C7=CC(=C(C=C7)OC)OC)O)OC)O)OC)OC)O)COC |
| SMILES (Isomeric) | CCN1C[C@@]2([C@@H](C[C@@H]([C@@]34[C@@H]2[C@H]([C@@H]([C@H]31)[C@]5(C[C@@H]([C@]6(C[C@@H]4[C@@H]5[C@H]6OC(=O)C7=CC(=C(C=C7)OC)OC)O)OC)O)OC)OC)O)COC |
| InChI | InChI=1S/C34H49NO11/c1-8-35-15-31(16-40-2)21(36)12-22(43-5)34-18-13-32(38)23(44-6)14-33(39,25(28(34)35)26(45-7)27(31)34)24(18)29(32)46-30(37)17-9-10-19(41-3)20(11-17)42-4/h9-11,18,21-29,36,38-39H,8,12-16H2,1-7H3/t18-,21-,22+,23+,24-,25+,26+,27-,28-,29-,31+,32+,33-,34+/m1/s1 |
| InChI Key | MSRNKBZGCDRCCC-FGVKVMLJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H49NO11 |
| Molecular Weight | 647.80 g/mol |
| Exact Mass | 647.33056138 g/mol |
| Topological Polar Surface Area (TPSA) | 146.00 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.46% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.87% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.65% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.41% | 90.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.42% | 92.94% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.15% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.72% | 98.95% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 90.62% | 87.16% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.73% | 83.82% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.52% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.44% | 94.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.34% | 91.19% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.63% | 96.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.43% | 96.90% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.04% | 97.25% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.95% | 90.24% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.25% | 97.09% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 81.89% | 85.83% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.35% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.23% | 92.62% |
| CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 80.61% | 87.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163083749 |
| LOTUS | LTS0197108 |
| wikiData | Q105171358 |