(3beta,5alpha,6alpha,23R,25S)-3,23-Dihydroxyspirostan-6-yl 6-deoxy-3-O-beta-D-xylopyranosyl-beta-D-glucopyranoside
Internal ID | 7b927990-0bdd-4eea-a1ee-affbb0a43edd |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4S,5R)-2-[(2R,3R,4S,5R,6R)-2-[(1R,2S,3'R,4S,5'S,6S,7S,8R,9S,12S,13R,16S,18S,19S)-3',16-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-19-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl]oxyoxane-3,4,5-triol |
SMILES (Canonical) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CC(C6C5(CCC(C6)O)C)OC7C(C(C(C(O7)C)O)OC8C(C(C(CO8)O)O)O)O)C)C)OC1)O |
SMILES (Isomeric) | C[C@H]1C[C@H]([C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4C[C@@H]([C@@H]6[C@@]5(CC[C@@H](C6)O)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)C)C)OC1)O |
InChI | InChI=1S/C38H62O13/c1-16-10-27(41)38(47-14-16)17(2)28-26(51-38)13-22-20-12-25(23-11-19(39)6-8-36(23,4)21(20)7-9-37(22,28)5)49-35-32(45)33(29(42)18(3)48-35)50-34-31(44)30(43)24(40)15-46-34/h16-35,39-45H,6-15H2,1-5H3/t16-,17-,18+,19-,20+,21-,22-,23+,24+,25-,26-,27+,28-,29+,30-,31+,32+,33-,34-,35-,36+,37-,38-/m0/s1 |
InChI Key | FOCICMJCJFCWOL-XFQGNVHUSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C38H62O13 |
Molecular Weight | 726.90 g/mol |
Exact Mass | 726.41904203 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | 1.60 |
DTXSID701116013 |
(3beta,5alpha,6alpha,23R,25S)-3,23-Dihydroxyspirostan-6-yl 6-deoxy-3-O-beta-D-xylopyranosyl-beta-D-glucopyranoside |
713144-09-3 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.87% | 91.11% |
CHEMBL204 | P00734 | Thrombin | 96.25% | 96.01% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.26% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.30% | 92.94% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 94.24% | 97.31% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 92.85% | 92.88% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.18% | 96.61% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 91.34% | 95.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 90.73% | 92.78% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 89.83% | 97.86% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.82% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 89.73% | 96.43% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.54% | 96.77% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.38% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.17% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.12% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.53% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.15% | 86.33% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.90% | 95.58% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.90% | 95.89% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 86.25% | 98.99% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.66% | 97.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.96% | 97.09% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.95% | 97.21% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.85% | 83.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.76% | 97.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.95% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.53% | 97.25% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 81.47% | 95.36% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.28% | 91.19% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.26% | 92.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.18% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum asperolanatum |
Solanum torvum |
PubChem | 44559498 |
LOTUS | LTS0132771 |
wikiData | Q104998699 |