[8-Hydroxy-10-methyl-14-(2-methylbutanoyloxy)-11-oxo-4,12-dioxapentacyclo[7.7.0.01,6.02,13.010,15]hexadec-2-en-5-yl] 3-hydroxy-2-methylbutanoate
| Internal ID | c51fd991-9745-4c7d-abf1-daca7c8b7b9f |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [8-hydroxy-10-methyl-14-(2-methylbutanoyloxy)-11-oxo-4,12-dioxapentacyclo[7.7.0.01,6.02,13.010,15]hexadec-2-en-5-yl] 3-hydroxy-2-methylbutanoate |
| SMILES (Canonical) | CCC(C)C(=O)OC1C2CC34C5CC(C3C2(C(=O)OC1C4=COC5OC(=O)C(C)C(C)O)C)O |
| SMILES (Isomeric) | CCC(C)C(=O)OC1C2CC34C5CC(C3C2(C(=O)OC1C4=COC5OC(=O)C(C)C(C)O)C)O |
| InChI | InChI=1S/C25H34O9/c1-6-10(2)20(28)32-17-14-8-25-13-7-16(27)19(25)24(14,5)23(30)33-18(17)15(25)9-31-22(13)34-21(29)11(3)12(4)26/h9-14,16-19,22,26-27H,6-8H2,1-5H3 |
| InChI Key | AEMNOUFSJNXGFJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H34O9 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.22028266 g/mol |
| Topological Polar Surface Area (TPSA) | 129.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of [8-Hydroxy-10-methyl-14-(2-methylbutanoyloxy)-11-oxo-4,12-dioxapentacyclo[7.7.0.01,6.02,13.010,15]hexadec-2-en-5-yl] 3-hydroxy-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/ff7ef3c0-8635-11ee-8d39-fd8af944b0fe.jpg "2D Structure of [8-Hydroxy-10-methyl-14-(2-methylbutanoyloxy)-11-oxo-4,12-dioxapentacyclo[7.7.0.01,6.02,13.010,15]hexadec-2-en-5-yl] 3-hydroxy-2-methylbutanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.87% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.02% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.62% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.38% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.88% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.57% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.21% | 94.45% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 89.15% | 98.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.99% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.42% | 97.14% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.11% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.48% | 99.23% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.80% | 97.79% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.14% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.40% | 89.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.96% | 91.07% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.17% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Trixis grisebachii |
| PubChem | 14355447 |
| LOTUS | LTS0163910 |
| wikiData | Q104910155 |