(4E,12S,13R)-5,10-dimethyl-8,14,16-trioxatetracyclo[10.2.2.01,13.07,11]hexadeca-4,7(11),9-trien-15-one
Internal ID | b0c3bb79-fc68-4ae9-8f38-8e1556d076e0 |
Taxonomy | Organoheterocyclic compounds > Dioxanes > 1,4-dioxanes |
IUPAC Name | (4E,12S,13R)-5,10-dimethyl-8,14,16-trioxatetracyclo[10.2.2.01,13.07,11]hexadeca-4,7(11),9-trien-15-one |
SMILES (Canonical) | CC1=CCCC23C(O2)C(C4=C(C1)OC=C4C)OC3=O |
SMILES (Isomeric) | C/C/1=C\CCC23[C@H](O2)[C@H](C4=C(C1)OC=C4C)OC3=O |
InChI | InChI=1S/C15H16O4/c1-8-4-3-5-15-13(19-15)12(18-14(15)16)11-9(2)7-17-10(11)6-8/h4,7,12-13H,3,5-6H2,1-2H3/b8-4+/t12-,13+,15?/m0/s1 |
InChI Key | KBMSVODXFLAQNJ-WDIVDLRRSA-N |
Popularity | 4 references in papers |
Molecular Formula | C15H16O4 |
Molecular Weight | 260.28 g/mol |
Exact Mass | 260.10485899 g/mol |
Topological Polar Surface Area (TPSA) | 52.00 Ų |
XlogP | 1.90 |
HY-N0688 |
CS-0009712 |
![2D Structure of (4E,12S,13R)-5,10-dimethyl-8,14,16-trioxatetracyclo[10.2.2.01,13.07,11]hexadeca-4,7(11),9-trien-15-one 2D Structure of (4E,12S,13R)-5,10-dimethyl-8,14,16-trioxatetracyclo[10.2.2.01,13.07,11]hexadeca-4,7(11),9-trien-15-one](https://plantaedb.com/storage/docs/compounds/2023/11/ff6f4b40-854a-11ee-bdbb-e51ae6fb2f04.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.80% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.65% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.88% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.41% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.72% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.58% | 89.00% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.41% | 89.63% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.22% | 94.73% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 81.76% | 90.93% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 80.28% | 92.51% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cryptocarya densiflora |
Lindera aggregata |
Neolitsea buisanensis |
Neolitsea hiiranensis |
Neolitsea parvigemma |
Neolitsea villosa |
PubChem | 146014458 |
LOTUS | LTS0070170 |
wikiData | Q104398633 |