2-(hydroxymethyl)-4-[(2S,3R)-3-(hydroxymethyl)-5-[(E)-3-hydroxyprop-1-enyl]-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]phenol
Internal ID | dca75a0f-22f3-4a6c-9bb0-d6280e2a9eea |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-(hydroxymethyl)-4-[(2S,3R)-3-(hydroxymethyl)-5-[(E)-3-hydroxyprop-1-enyl]-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]phenol |
SMILES (Canonical) | COC1=CC(=CC2=C1OC(C2CO)C3=CC(=C(C=C3)O)CO)C=CCO |
SMILES (Isomeric) | COC1=CC(=CC2=C1O[C@@H]([C@H]2CO)C3=CC(=C(C=C3)O)CO)/C=C/CO |
InChI | InChI=1S/C20H22O6/c1-25-18-8-12(3-2-6-21)7-15-16(11-23)19(26-20(15)18)13-4-5-17(24)14(9-13)10-22/h2-5,7-9,16,19,21-24H,6,10-11H2,1H3/b3-2+/t16-,19+/m0/s1 |
InChI Key | VRNSHBSCENBOKC-BAXQNQMVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O6 |
Molecular Weight | 358.40 g/mol |
Exact Mass | 358.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 99.40 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.03% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.01% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.34% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.06% | 96.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.18% | 91.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.72% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.93% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.55% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.83% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.47% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.19% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 85.76% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.10% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.76% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.95% | 99.15% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.47% | 80.78% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.24% | 93.99% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.13% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Magnolia biondii |
PubChem | 163189510 |
LOTUS | LTS0090297 |
wikiData | Q105291867 |