[(1R,2R,3S,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] (3S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate
Internal ID | 54fc98c8-3a96-4a79-b58d-1632b284bba6 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | [(1R,2R,3S,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] (3S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoate |
SMILES (Canonical) | CC(CC(=O)OC1C2C(C(C(C1O)O)O)NC(=O)C3=C(C4=C(C=C23)OCO4)O)OC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | C[C@@H](CC(=O)O[C@@H]1[C@H]2[C@H]([C@@H]([C@@H]([C@H]1O)O)O)NC(=O)C3=C(C4=C(C=C23)OCO4)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O |
InChI | InChI=1S/C24H31NO15/c1-6(38-24-20(34)17(31)14(28)9(4-26)39-24)2-10(27)40-22-11-7-3-8-21(37-5-36-8)15(29)12(7)23(35)25-13(11)16(30)18(32)19(22)33/h3,6,9,11,13-14,16-20,22,24,26,28-34H,2,4-5H2,1H3,(H,25,35)/t6-,9+,11+,13+,14+,16-,17-,18-,19+,20+,22+,24+/m0/s1 |
InChI Key | QGRGVCXBYQUGHI-PKUULSAOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H31NO15 |
Molecular Weight | 573.50 g/mol |
Exact Mass | 573.16936928 g/mol |
Topological Polar Surface Area (TPSA) | 254.00 Ų |
XlogP | -2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.75% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.26% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 97.78% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.28% | 96.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.72% | 96.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.37% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.44% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.78% | 96.77% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.22% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.06% | 99.15% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.33% | 95.93% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.31% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.23% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.60% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.55% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.45% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.44% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.84% | 100.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.36% | 95.64% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.95% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.79% | 99.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.40% | 92.50% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.71% | 89.34% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.56% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zephyranthes carinata |
PubChem | 101147060 |
LOTUS | LTS0238604 |
wikiData | Q105220574 |