(8-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6,6a,7,8-hexahydro-3aH-benzo[h][1]benzofuran-4-yl) 2-[2-(acetyloxymethyl)but-2-enoyloxymethyl]-4-hydroxybut-2-enoate
Internal ID | 8a34760a-8960-447d-bf9e-61c483a4980b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (8-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6,6a,7,8-hexahydro-3aH-benzo[h][1]benzofuran-4-yl) 2-[2-(acetyloxymethyl)but-2-enoyloxymethyl]-4-hydroxybut-2-enoate |
SMILES (Canonical) | CC=C(COC(=O)C)C(=O)OCC(=CCO)C(=O)OC1CC(C2CC(C(=CC23C1C(=C)C(=O)O3)C)O)C |
SMILES (Isomeric) | CC=C(COC(=O)C)C(=O)OCC(=CCO)C(=O)OC1CC(C2CC(C(=CC23C1C(=C)C(=O)O3)C)O)C |
InChI | InChI=1S/C27H34O10/c1-6-18(12-34-17(5)29)25(32)35-13-19(7-8-28)26(33)36-22-9-14(2)20-10-21(30)15(3)11-27(20)23(22)16(4)24(31)37-27/h6-7,11,14,20-23,28,30H,4,8-10,12-13H2,1-3,5H3 |
InChI Key | DBHPVAXUHNRLFC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H34O10 |
Molecular Weight | 518.60 g/mol |
Exact Mass | 518.21519728 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
![2D Structure of (8-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6,6a,7,8-hexahydro-3aH-benzo[h][1]benzofuran-4-yl) 2-[2-(acetyloxymethyl)but-2-enoyloxymethyl]-4-hydroxybut-2-enoate 2D Structure of (8-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6,6a,7,8-hexahydro-3aH-benzo[h][1]benzofuran-4-yl) 2-[2-(acetyloxymethyl)but-2-enoyloxymethyl]-4-hydroxybut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/ff410860-85ad-11ee-b143-9988b8e300be.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.98% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.26% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.52% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.70% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.46% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 90.15% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.71% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.17% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.19% | 89.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.28% | 94.80% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.19% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.15% | 99.23% |
CHEMBL5028 | O14672 | ADAM10 | 83.94% | 97.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.84% | 91.07% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.06% | 94.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.07% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.72% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.17% | 96.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.01% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mikania haenkeana |
PubChem | 163066968 |
LOTUS | LTS0184645 |
wikiData | Q104974398 |