(11R,12S,15S)-11-bromo-12,21-dihydroxy-15-(2-hydroxypropan-2-yl)-4,12-dimethyl-7-methylidene-16-oxatricyclo[16.3.1.03,8]docosa-1(21),3,18(22),19-tetraen-17-one
Internal ID | 70f03f1c-6a64-486d-a011-496d08b67f8a |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | (11R,12S,15S)-11-bromo-12,21-dihydroxy-15-(2-hydroxypropan-2-yl)-4,12-dimethyl-7-methylidene-16-oxatricyclo[16.3.1.03,8]docosa-1(21),3,18(22),19-tetraen-17-one |
SMILES (Canonical) | CC1=C2CC3=C(C=CC(=C3)C(=O)OC(CCC(C(CCC2C(=C)CC1)Br)(C)O)C(C)(C)O)O |
SMILES (Isomeric) | CC1=C2CC3=C(C=CC(=C3)C(=O)O[C@@H](CC[C@]([C@@H](CCC2C(=C)CC1)Br)(C)O)C(C)(C)O)O |
InChI | InChI=1S/C27H37BrO5/c1-16-6-7-17(2)21-15-19-14-18(8-10-22(19)29)25(30)33-24(26(3,4)31)12-13-27(5,32)23(28)11-9-20(16)21/h8,10,14,20,23-24,29,31-32H,1,6-7,9,11-13,15H2,2-5H3/t20?,23-,24+,27+/m1/s1 |
InChI Key | LWYZNBXETNJHDW-OBWQYEKRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H37BrO5 |
Molecular Weight | 521.50 g/mol |
Exact Mass | 520.18244 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 4.30 |
There are no found synonyms. |
![2D Structure of (11R,12S,15S)-11-bromo-12,21-dihydroxy-15-(2-hydroxypropan-2-yl)-4,12-dimethyl-7-methylidene-16-oxatricyclo[16.3.1.03,8]docosa-1(21),3,18(22),19-tetraen-17-one 2D Structure of (11R,12S,15S)-11-bromo-12,21-dihydroxy-15-(2-hydroxypropan-2-yl)-4,12-dimethyl-7-methylidene-16-oxatricyclo[16.3.1.03,8]docosa-1(21),3,18(22),19-tetraen-17-one](https://plantaedb.com/storage/docs/compounds/2023/11/feeb0750-8594-11ee-a881-1d69153ddd59.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 97.03% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.30% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 94.03% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.05% | 92.94% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.79% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.51% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.96% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.83% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.53% | 94.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.51% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.50% | 99.23% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.73% | 89.63% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.93% | 99.15% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.74% | 100.00% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 84.85% | 90.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.09% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.03% | 93.04% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.76% | 93.99% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.73% | 93.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.81% | 97.25% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.14% | 91.49% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.71% | 95.53% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.43% | 96.21% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.24% | 93.31% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.11% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carphochaete bigelovii |
Hymenopappus scabiosaeus |
Liatris provincialis |
Mikania haenkeana |
PubChem | 42599771 |
LOTUS | LTS0095533 |
wikiData | Q105243243 |