(1R,2S,3'S,4R,4'S,5'S,6S,7S,8R,9R,12S,13R,14R,16R)-3',16-dihydroxy-14-[(2S,3R,4S,5S)-5-hydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5',7,9,13-tetramethyl-4'-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3-one
| Internal ID | afc01131-805d-4d39-9e6d-fc363147688a |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (1R,2S,3'S,4R,4'S,5'S,6S,7S,8R,9R,12S,13R,14R,16R)-3',16-dihydroxy-14-[(2S,3R,4S,5S)-5-hydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5',7,9,13-tetramethyl-4'-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3-one |
| SMILES (Canonical) | CC1COC2(C(C3C(O2)C(=O)C4C3(CCC5C4CC=C6C5(C(CC(C6)O)OC7C(C(C(CO7)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)C(C1OC1C(C(C(C(O1)C)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1CO[C@]2([C@H]([C@H]3[C@@H](O2)C(=O)[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5([C@@H](C[C@@H](C6)O)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)C)[C@H]([C@H]1O[C@H]1[C@@H]([C@@H]([C@H]([C@H](O1)C)O)O)O)O |
| InChI | InChI=1S/C49H76O23/c1-16-13-65-49(42(62)38(16)69-44-36(60)33(57)29(53)18(3)66-44)17(2)27-40(72-49)32(56)28-22-8-7-20-11-21(50)12-26(48(20,6)23(22)9-10-47(27,28)5)68-46-41(71-45-37(61)34(58)30(54)19(4)67-45)39(25(52)15-64-46)70-43-35(59)31(55)24(51)14-63-43/h7,16-19,21-31,33-46,50-55,57-62H,8-15H2,1-6H3/t16-,17-,18+,19-,21+,22+,23-,24+,25-,26+,27-,28+,29-,30-,31-,33+,34+,35+,36+,37+,38-,39-,40+,41+,42-,43-,44-,45-,46-,47+,48-,49-/m0/s1 |
| InChI Key | VSQUWGKBZKYBQR-OYHQEKSLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C49H76O23 |
| Molecular Weight | 1033.10 g/mol |
| Exact Mass | 1032.47773867 g/mol |
| Topological Polar Surface Area (TPSA) | 352.00 Ų |
| XlogP | -3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.53% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.07% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.26% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.10% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.41% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.16% | 97.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.69% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.65% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.50% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.41% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.94% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.40% | 94.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.29% | 97.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.08% | 90.17% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.42% | 93.04% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 84.75% | 95.92% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.51% | 94.73% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.84% | 96.43% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.66% | 92.62% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.69% | 97.36% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.40% | 92.94% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.15% | 92.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.05% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ornithogalum thyrsoides |
| PubChem | 101394577 |
| LOTUS | LTS0130805 |
| wikiData | Q105292448 |