[(4aR,5R,6R,6aS,7R,11aR,11bR)-4a,6-dihydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,7,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] (E)-3-phenylprop-2-enoate
| Internal ID | a45d1600-8f6f-4316-802d-86a15c6d9610 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | [(4aR,5R,6R,6aS,7R,11aR,11bR)-4a,6-dihydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,7,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] (E)-3-phenylprop-2-enoate |
| SMILES (Canonical) | CC1C2C(C=C3C1=CC(=O)O3)C4(CCCC(C4(C(C2O)OC(=O)C=CC5=CC=CC=C5)O)(C)C)C |
| SMILES (Isomeric) | C[C@@H]1[C@H]2[C@H](C=C3C1=CC(=O)O3)[C@]4(CCCC([C@@]4([C@@H]([C@@H]2O)OC(=O)/C=C/C5=CC=CC=C5)O)(C)C)C |
| InChI | InChI=1S/C29H34O6/c1-17-19-15-23(31)34-21(19)16-20-24(17)25(32)26(29(33)27(2,3)13-8-14-28(20,29)4)35-22(30)12-11-18-9-6-5-7-10-18/h5-7,9-12,15-17,20,24-26,32-33H,8,13-14H2,1-4H3/b12-11+/t17-,20-,24-,25+,26+,28+,29+/m0/s1 |
| InChI Key | ATXDIAGUPUENCR-LSBQCYCWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.23553880 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.64% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.20% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.68% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.73% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.64% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.22% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.07% | 96.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.67% | 93.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.72% | 89.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.64% | 91.07% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.21% | 95.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.44% | 90.17% |
| CHEMBL5028 | O14672 | ADAM10 | 85.28% | 97.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.56% | 96.00% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 83.92% | 92.51% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.80% | 97.33% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.47% | 83.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.74% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.95% | 97.25% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.90% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Caesalpinia pulcherrima |
| PubChem | 162935747 |
| LOTUS | LTS0182212 |
| wikiData | Q104918734 |