(1R,3S)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-8-ol
| Internal ID | f0024517-eb53-429e-b3a6-9521b3448b23 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
| IUPAC Name | (1R,3S)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-8-ol |
| SMILES (Canonical) | CC1CC2=CC(=C(C(=C2C(N1C)C)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC)OC |
| SMILES (Isomeric) | C[C@H]1CC2=CC(=C(C(=C2[C@H](N1C)C)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC)OC |
| InChI | InChI=1S/C26H31NO4/c1-14-11-20(30-6)24-18(9-8-10-19(24)29-5)22(14)25-21(31-7)13-17-12-15(2)27(4)16(3)23(17)26(25)28/h8-11,13,15-16,28H,12H2,1-7H3/t15-,16+/m0/s1 |
| InChI Key | PGHJSNHPVCVQPJ-JKSUJKDBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.22530847 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 5.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.06% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.07% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.31% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.15% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 95.03% | 89.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.20% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.68% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.35% | 93.99% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.42% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.66% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.11% | 99.15% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 90.15% | 95.62% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 88.76% | 100.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 87.88% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.43% | 91.49% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.12% | 93.31% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.03% | 94.45% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 86.75% | 97.31% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 86.03% | 91.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.55% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.23% | 94.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.25% | 93.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.69% | 90.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.92% | 94.03% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.33% | 93.65% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.24% | 97.14% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.21% | 89.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.21% | 99.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.13% | 97.21% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.76% | 95.34% |
| CHEMBL1795185 | Q58F21 | Bromodomain testis-specific protein | 80.55% | 89.76% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.05% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ancistrocladus abbreviatus |
| Ancistrocladus barteri |
| PubChem | 101664024 |
| LOTUS | LTS0269629 |
| wikiData | Q105208394 |