[(3S,4aR,6aR,8S,10R,10aR,10bS)-3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] acetate
| Internal ID | fab096e4-524d-4165-a4e5-919fa04d2d54 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(3S,4aR,6aR,8S,10R,10aR,10bS)-3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC(C(C2C1(C3CCC(OC3(C(=O)C2)C)(C)C=C)C)(C)C)O |
| SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@@H](C([C@@H]2[C@@]1([C@@H]3CC[C@@](O[C@]3(C(=O)C2)C)(C)C=C)C)(C)C)O |
| InChI | InChI=1S/C22H34O5/c1-8-20(5)10-9-14-21(6)15(11-17(25)22(14,7)27-20)19(3,4)16(24)12-18(21)26-13(2)23/h8,14-16,18,24H,1,9-12H2,2-7H3/t14-,15+,16-,18+,20+,21-,22+/m0/s1 |
| InChI Key | QBQNQLFIKUUYCI-JDQAEWLXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.24062418 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of [(3S,4aR,6aR,8S,10R,10aR,10bS)-3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/fe3b9c80-8635-11ee-a64b-4f40eb579ca4.jpg "2D Structure of [(3S,4aR,6aR,8S,10R,10aR,10bS)-3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.29% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.58% | 91.19% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.37% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.98% | 94.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.36% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.18% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.43% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.30% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.36% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.85% | 85.14% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 84.66% | 98.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.56% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.45% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.88% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.24% | 93.04% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.62% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.04% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Helichrysum ambiguum |
| PubChem | 14262711 |
| LOTUS | LTS0184668 |
| wikiData | Q105217954 |