(1R,9S)-11-hydroxy-14-(1H-imidazol-5-ylmethylidene)-2-methoxy-9-(2-methylbut-3-en-2-yl)-2,13,16-triazatetracyclo[7.7.0.01,13.03,8]hexadeca-3,5,7,10-tetraene-12,15-dione
| Internal ID | 9ad14e42-cc26-4658-831b-e20f9b6769ba |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Pyridoindolones |
| IUPAC Name | (1R,9S)-11-hydroxy-14-(1H-imidazol-5-ylmethylidene)-2-methoxy-9-(2-methylbut-3-en-2-yl)-2,13,16-triazatetracyclo[7.7.0.01,13.03,8]hexadeca-3,5,7,10-tetraene-12,15-dione |
| SMILES (Canonical) | CC(C)(C=C)C12C=C(C(=O)N3C1(NC(=O)C3=CC4=CN=CN4)N(C5=CC=CC=C25)OC)O |
| SMILES (Isomeric) | CC(C)(C=C)[C@]12C=C(C(=O)N3[C@@]1(NC(=O)C3=CC4=CN=CN4)N(C5=CC=CC=C25)OC)O |
| InChI | InChI=1S/C23H23N5O4/c1-5-21(2,3)22-11-18(29)20(31)27-17(10-14-12-24-13-25-14)19(30)26-23(22,27)28(32-4)16-9-7-6-8-15(16)22/h5-13,29H,1H2,2-4H3,(H,24,25)(H,26,30)/t22-,23-/m1/s1 |
| InChI Key | JTJJJLSLKZFEPJ-DHIUTWEWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.17500423 g/mol |
| Topological Polar Surface Area (TPSA) | 111.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.20% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.56% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.45% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.12% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.01% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.30% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.15% | 98.75% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 89.72% | 93.65% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.27% | 85.14% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.27% | 94.62% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.62% | 91.07% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.97% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.93% | 94.45% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 86.41% | 96.39% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 85.34% | 88.84% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.25% | 93.03% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.10% | 94.08% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.18% | 94.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.22% | 92.88% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.38% | 91.38% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.38% | 100.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.69% | 97.36% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.07% | 95.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162950598 |
| LOTUS | LTS0168154 |
| wikiData | Q105134800 |