5,6-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-methoxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | eaa06108-ad86-48bd-97e9-0aa0e4ac2823 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5,6-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-methoxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)O)OC)O |
InChI | InChI=1S/C23H24O13/c1-32-10-5-8(3-4-9(10)25)21-22(33-2)18(29)14-11(34-21)6-12(15(26)17(14)28)35-23-20(31)19(30)16(27)13(7-24)36-23/h3-6,13,16,19-20,23-28,30-31H,7H2,1-2H3 |
InChI Key | RCEFANLBVZSGRB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O13 |
Molecular Weight | 508.40 g/mol |
Exact Mass | 508.12169082 g/mol |
Topological Polar Surface Area (TPSA) | 205.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of 5,6-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-methoxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one 2D Structure of 5,6-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-methoxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/fdd7aa10-8737-11ee-b39b-edf792c05a42.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.75% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.32% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.84% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.82% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.17% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.12% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.64% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.97% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.23% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.15% | 86.92% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 87.37% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.77% | 94.73% |
CHEMBL220 | P22303 | Acetylcholinesterase | 86.51% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.29% | 95.56% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.98% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.38% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.01% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.07% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clibadium terebinthinaceum |
PubChem | 74978474 |
LOTUS | LTS0131583 |
wikiData | Q105233568 |