5-[2-(Furan-3-yl)ethyl]-1,4a,6-trimethyl-3-(3-methylpent-2-enoyloxy)-2,3,4,5,8,8a-hexahydronaphthalene-1-carboxylic acid
| Internal ID | 74ef015c-cee5-43e1-a25f-a8ebc1bd434c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
| IUPAC Name | 5-[2-(furan-3-yl)ethyl]-1,4a,6-trimethyl-3-(3-methylpent-2-enoyloxy)-2,3,4,5,8,8a-hexahydronaphthalene-1-carboxylic acid |
| SMILES (Canonical) | CCC(=CC(=O)OC1CC2(C(CC=C(C2CCC3=COC=C3)C)C(C1)(C)C(=O)O)C)C |
| SMILES (Isomeric) | CCC(=CC(=O)OC1CC2(C(CC=C(C2CCC3=COC=C3)C)C(C1)(C)C(=O)O)C)C |
| InChI | InChI=1S/C26H36O5/c1-6-17(2)13-23(27)31-20-14-25(4)21(9-8-19-11-12-30-16-19)18(3)7-10-22(25)26(5,15-20)24(28)29/h7,11-13,16,20-22H,6,8-10,14-15H2,1-5H3,(H,28,29) |
| InChI Key | WLTQSDWXXMORST-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.25627424 g/mol |
| Topological Polar Surface Area (TPSA) | 76.70 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
![2D Structure of 5-[2-(Furan-3-yl)ethyl]-1,4a,6-trimethyl-3-(3-methylpent-2-enoyloxy)-2,3,4,5,8,8a-hexahydronaphthalene-1-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/fdb984c0-85bb-11ee-a555-dbfa390d41af.jpg "2D Structure of 5-[2-(Furan-3-yl)ethyl]-1,4a,6-trimethyl-3-(3-methylpent-2-enoyloxy)-2,3,4,5,8,8a-hexahydronaphthalene-1-carboxylic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.31% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.41% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.08% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.86% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.38% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.50% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.10% | 86.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.87% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.76% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.54% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.53% | 93.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.46% | 89.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.24% | 91.71% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.72% | 94.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.97% | 95.89% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.45% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gutierrezia resinosa |
| PubChem | 163092345 |
| LOTUS | LTS0086435 |
| wikiData | Q105308209 |