[(2R,3S,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2'R,3S,3'R,4'R,5aR,7S,9R,9aR)-7-[(1S)-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',9-dimethylspiro[4,5a,6,7,9,9a-hexahydropyrano[3,4-c][1,2,5]trioxepine-3,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-3-methoxy-2-methyloxan-4-yl] acetate
Internal ID | bed374f5-f8bc-4401-a229-3fa480d0c96d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(2R,3S,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2'R,3S,3'R,4'R,5aR,7S,9R,9aR)-7-[(1S)-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',9-dimethylspiro[4,5a,6,7,9,9a-hexahydropyrano[3,4-c][1,2,5]trioxepine-3,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-3-methoxy-2-methyloxan-4-yl] acetate |
SMILES (Canonical) | CC1C2C(CC(O1)OC(C)C3(CCC4C3(CCC5C4CC=C6C5(CCC(C6)O)C)C)O)OCC7(CC(C(C(O7)C)OC8CC(C(C(O8)C)OC9CC(C(C(O9)C)OC1CC(C(C(O1)C)OC1CC(C(C(O1)C)OC)OC(=O)C)OC)OC)OC)OC)OO2 |
SMILES (Isomeric) | C[C@@H]1[C@@H]2[C@@H](C[C@@H](O1)O[C@@H](C)[C@]3(CC[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O)C)C)O)OC[C@]7(C[C@H]([C@@H]([C@H](O7)C)O[C@H]8C[C@@H]([C@@H]([C@H](O8)C)O[C@H]9C[C@@H]([C@@H]([C@H](O9)C)O[C@H]1C[C@@H]([C@@H]([C@H](O1)C)O[C@H]1C[C@@H]([C@H]([C@H](O1)C)OC)OC(=O)C)OC)OC)OC)OC)OO2 |
InChI | InChI=1S/C65H106O23/c1-32-56(73-15)49(81-39(8)66)29-55(75-32)84-59-35(4)77-53(26-46(59)70-12)82-57-33(2)76-52(25-45(57)69-11)83-58-34(3)78-54(27-47(58)71-13)85-60-37(6)86-64(30-50(60)72-14)31-74-48-28-51(79-36(5)61(48)87-88-64)80-38(7)65(68)23-20-44-42-17-16-40-24-41(67)18-21-62(40,9)43(42)19-22-63(44,65)10/h16,32-38,41-61,67-68H,17-31H2,1-15H3/t32-,33-,34-,35-,36-,37-,38+,41+,42-,43+,44+,45+,46+,47+,48-,49+,50-,51+,52+,53+,54+,55+,56+,57-,58-,59-,60-,61-,62+,63+,64+,65+/m1/s1 |
InChI Key | UWLPLZCBXNDJEF-QUAZRGMDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C65H106O23 |
Molecular Weight | 1255.50 g/mol |
Exact Mass | 1254.71248962 g/mol |
Topological Polar Surface Area (TPSA) | 242.00 Ų |
XlogP | 5.60 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2'R,3S,3'R,4'R,5aR,7S,9R,9aR)-7-[(1S)-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',9-dimethylspiro[4,5a,6,7,9,9a-hexahydropyrano[3,4-c][1,2,5]trioxepine-3,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-3-methoxy-2-methyloxan-4-yl] acetate 2D Structure of [(2R,3S,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2'R,3S,3'R,4'R,5aR,7S,9R,9aR)-7-[(1S)-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',9-dimethylspiro[4,5a,6,7,9,9a-hexahydropyrano[3,4-c][1,2,5]trioxepine-3,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-3-methoxy-2-methyloxan-4-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/fd119160-85d7-11ee-9b0f-cffa76eca574.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.21% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.08% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.76% | 94.45% |
CHEMBL204 | P00734 | Thrombin | 97.31% | 96.01% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 96.95% | 95.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.84% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.14% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.18% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.75% | 91.19% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.42% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.32% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.12% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.88% | 95.93% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.87% | 89.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.14% | 89.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.56% | 97.28% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.12% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.05% | 97.14% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.65% | 95.71% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.57% | 93.56% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.03% | 92.88% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.76% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.35% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.92% | 92.62% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.87% | 93.40% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.75% | 99.23% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.43% | 91.07% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.40% | 94.08% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.65% | 96.95% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.31% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.04% | 97.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.64% | 97.33% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.31% | 100.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.09% | 91.03% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.85% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 162928754 |
LOTUS | LTS0197051 |
wikiData | Q105280444 |