(6R)-3,8-dihydroxy-10-methoxy-9-[(E)-3-methylbut-1-enyl]-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one
Internal ID | b32ad561-78f8-492d-a263-10e9277e97b6 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | (6R)-3,8-dihydroxy-10-methoxy-9-[(E)-3-methylbut-1-enyl]-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one |
SMILES (Canonical) | CC(C)C=CC1=C(C=C2C(=C1O)C(=O)C3=C(O2)C4=C(C=C(C=C4)O)OC3C=C(C)C)OC |
SMILES (Isomeric) | CC(C)/C=C/C1=C(C=C2C(=C1O)C(=O)C3=C(O2)C4=C(C=C(C=C4)O)O[C@@H]3C=C(C)C)OC |
InChI | InChI=1S/C26H26O6/c1-13(2)6-8-16-18(30-5)12-21-22(24(16)28)25(29)23-20(10-14(3)4)31-19-11-15(27)7-9-17(19)26(23)32-21/h6-13,20,27-28H,1-5H3/b8-6+/t20-/m1/s1 |
InChI Key | FWIXOUMETCCFPO-CPSHHHPTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H26O6 |
Molecular Weight | 434.50 g/mol |
Exact Mass | 434.17293854 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 6.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.88% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.33% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.73% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.81% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.27% | 94.00% |
CHEMBL3194 | P02766 | Transthyretin | 90.33% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.80% | 96.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.70% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.56% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.94% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.56% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.75% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.43% | 85.14% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.45% | 89.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.37% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.68% | 97.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.04% | 96.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.65% | 89.62% |
CHEMBL2535 | P11166 | Glucose transporter | 82.91% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.84% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.78% | 95.89% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.75% | 93.10% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.94% | 94.42% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.60% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 163035061 |
LOTUS | LTS0216299 |
wikiData | Q105003305 |