[(3S,4S,5S,6R)-6-[[3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoyl]oxymethyl]-4,5-dihydroxyoxan-3-yl] 3,4,5-trihydroxybenzoate
Internal ID | 4a7a16ea-6149-4c3a-887f-59c5bd830c76 |
Taxonomy | Phenylpropanoids and polyketides > Depsides and depsidones |
IUPAC Name | [(3S,4S,5S,6R)-6-[[3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoyl]oxymethyl]-4,5-dihydroxyoxan-3-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(C(C(C(O1)COC(=O)C2=CC(=C(C(=C2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)C2=CC(=C(C(=C2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
InChI | InChI=1S/C27H24O17/c28-12-1-9(2-13(29)20(12)33)26(39)43-17-6-11(5-16(32)22(17)35)25(38)42-7-18-23(36)24(37)19(8-41-18)44-27(40)10-3-14(30)21(34)15(31)4-10/h1-6,18-19,23-24,28-37H,7-8H2/t18-,19+,23-,24-/m1/s1 |
InChI Key | OQICIWWCVHRKMG-RKGYPADOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H24O17 |
Molecular Weight | 620.50 g/mol |
Exact Mass | 620.10134929 g/mol |
Topological Polar Surface Area (TPSA) | 290.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.07% | 91.11% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.51% | 95.17% |
CHEMBL3194 | P02766 | Transthyretin | 93.93% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.44% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.03% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.97% | 89.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.53% | 83.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.43% | 94.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.91% | 97.21% |
CHEMBL2581 | P07339 | Cathepsin D | 85.80% | 98.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.44% | 90.71% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.95% | 96.95% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.42% | 83.57% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.35% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.60% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 82.57% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.47% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acer tataricum subsp. ginnala |
PubChem | 14682435 |
LOTUS | LTS0216507 |
wikiData | Q105196839 |