[4-[3,4-Dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]-2-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | e7fff5d7-5921-4a81-9149-10919a4530d1 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [4-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]-2-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OCCC3=CC(=C(C=C3)OC)O)O)OC4C(C(CO4)(CO)O)O)OC(=O)C=CC5=CC(=C(C=C5)O)OC)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OCCC3=CC(=C(C=C3)OC)O)O)OC4C(C(CO4)(CO)O)O)OC(=O)C=CC5=CC(=C(C=C5)O)OC)O)O)O |
InChI | InChI=1S/C36H48O19/c1-17-26(41)27(42)28(43)33(52-17)50-14-24-30(54-25(40)9-6-18-4-7-20(38)23(13-18)48-3)31(55-35-32(45)36(46,15-37)16-51-35)29(44)34(53-24)49-11-10-19-5-8-22(47-2)21(39)12-19/h4-9,12-13,17,24,26-35,37-39,41-46H,10-11,14-16H2,1-3H3 |
InChI Key | IBZBYLPAHLAUMG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H48O19 |
Molecular Weight | 784.80 g/mol |
Exact Mass | 784.27897930 g/mol |
Topological Polar Surface Area (TPSA) | 282.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
![2D Structure of [4-[3,4-Dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]-2-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate 2D Structure of [4-[3,4-Dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-6-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]-2-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/fcac3910-8563-11ee-bc5d-2f2f22b55f20.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.70% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.66% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.38% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.74% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.59% | 89.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.08% | 92.98% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.99% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.78% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.72% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.46% | 92.94% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.12% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.50% | 97.36% |
CHEMBL3194 | P02766 | Transthyretin | 89.31% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.50% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.64% | 90.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.51% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.34% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.96% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.49% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.91% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.35% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 84.76% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.32% | 92.62% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.16% | 94.33% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.13% | 96.90% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.38% | 91.19% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.16% | 94.73% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.71% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pedicularis striata |
PubChem | 85131431 |
LOTUS | LTS0135792 |
wikiData | Q105110847 |