(1S,2R,7R,9S,11R)-2-methyl-15-[(1S)-1-[(2R,4S,5R,6R)-4,5,6-trihydroxy-4,5-dimethyloxan-2-yl]ethyl]-8-oxapentacyclo[9.8.0.02,7.07,9.012,17]nonadeca-4,12(17),13,15-tetraen-3-one
Internal ID | 7fd36034-c40e-4928-96f4-72af9b180104 |
Taxonomy | Benzenoids > Phenanthrenes and derivatives |
IUPAC Name | (1S,2R,7R,9S,11R)-2-methyl-15-[(1S)-1-[(2R,4S,5R,6R)-4,5,6-trihydroxy-4,5-dimethyloxan-2-yl]ethyl]-8-oxapentacyclo[9.8.0.02,7.07,9.012,17]nonadeca-4,12(17),13,15-tetraen-3-one |
SMILES (Canonical) | CC(C1CC(C(C(O1)O)(C)O)(C)O)C2=CC3=C(C=C2)C4CC5C6(O5)CC=CC(=O)C6(C4CC3)C |
SMILES (Isomeric) | C[C@H]([C@H]1C[C@]([C@@]([C@@H](O1)O)(C)O)(C)O)C2=CC3=C(C=C2)[C@@H]4C[C@H]5[C@@]6(O5)CC=CC(=O)[C@@]6([C@H]4CC3)C |
InChI | InChI=1S/C28H36O6/c1-15(21-14-25(2,31)27(4,32)24(30)33-21)16-7-9-18-17(12-16)8-10-20-19(18)13-23-28(34-23)11-5-6-22(29)26(20,28)3/h5-7,9,12,15,19-21,23-24,30-32H,8,10-11,13-14H2,1-4H3/t15-,19-,20-,21+,23-,24+,25-,26-,27-,28-/m0/s1 |
InChI Key | UPOXIHOCSBWLNQ-WIIKENQMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H36O6 |
Molecular Weight | 468.60 g/mol |
Exact Mass | 468.25118886 g/mol |
Topological Polar Surface Area (TPSA) | 99.50 Ų |
XlogP | 2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.51% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.75% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.80% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.80% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.36% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.58% | 95.93% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 93.45% | 95.69% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.98% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.97% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.62% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.92% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.82% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.77% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.05% | 97.25% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 88.71% | 100.00% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 88.69% | 85.11% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.48% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.99% | 95.89% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 85.80% | 92.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.96% | 92.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.40% | 91.19% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.52% | 96.61% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.26% | 93.03% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.17% | 90.24% |
CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 82.76% | 93.89% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 82.66% | 95.71% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.06% | 93.40% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.52% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.41% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.31% | 90.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.00% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salpichroa origanifolia |
PubChem | 21604158 |
LOTUS | LTS0115617 |
wikiData | Q105276920 |