3-(6,10-Dimethylundeca-5,9-dien-2-yl)-3,6,6,9a-tetramethyl-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalene
| Internal ID | 5a115be3-1f69-4100-8b40-da3f6b86c009 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 3-(6,10-dimethylundeca-5,9-dien-2-yl)-3,6,6,9a-tetramethyl-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalene |
| SMILES (Canonical) | CC(CCC=C(C)CCC=C(C)C)C1(CCC2=C1CCC3C2(CCCC3(C)C)C)C |
| SMILES (Isomeric) | CC(CCC=C(C)CCC=C(C)C)C1(CCC2=C1CCC3C2(CCCC3(C)C)C)C |
| InChI | InChI=1S/C30H50/c1-22(2)12-9-13-23(3)14-10-15-24(4)29(7)21-18-26-25(29)16-17-27-28(5,6)19-11-20-30(26,27)8/h12,14,24,27H,9-11,13,15-21H2,1-8H3 |
| InChI Key | JCONZYYZINSVKI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.391251595 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 10.50 |
| There are no found synonyms. |
![2D Structure of 3-(6,10-Dimethylundeca-5,9-dien-2-yl)-3,6,6,9a-tetramethyl-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalene](https://plantaedb.com/storage/docs/compounds/2023/11/fbf693f0-86f1-11ee-b04d-adcdfc390cf2.jpg "2D Structure of 3-(6,10-Dimethylundeca-5,9-dien-2-yl)-3,6,6,9a-tetramethyl-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.69% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.82% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.34% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.25% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.53% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.18% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.02% | 82.69% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.93% | 97.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.77% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.54% | 94.75% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.99% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.78% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.81% | 90.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.80% | 93.56% |
| CHEMBL233 | P35372 | Mu opioid receptor | 81.93% | 97.93% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.46% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.87% | 95.50% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 80.76% | 95.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162935001 |
| LOTUS | LTS0037364 |
| wikiData | Q105125013 |