(1S,4aS,10aR)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid
Internal ID | 16c26039-1a96-4a6f-a8b7-242892ecd91c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (1S,4aS,10aR)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
SMILES (Canonical) | CC12CCCC(C1CCC3=C2C=CC(=C3)C(C)(C)O)(C)C(=O)O |
SMILES (Isomeric) | C[C@]12CCC[C@]([C@@H]1CCC3=C2C=CC(=C3)C(C)(C)O)(C)C(=O)O |
InChI | InChI=1S/C20H28O3/c1-18(2,23)14-7-8-15-13(12-14)6-9-16-19(15,3)10-5-11-20(16,4)17(21)22/h7-8,12,16,23H,5-6,9-11H2,1-4H3,(H,21,22)/t16-,19-,20+/m1/s1 |
InChI Key | ILQLITDRYFHAGM-AHRSYUTCSA-N |
Popularity | 3 references in papers |
Molecular Formula | C20H28O3 |
Molecular Weight | 316.40 g/mol |
Exact Mass | 316.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 4.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5575 | Q15046 | Lysyl-tRNA synthetase |
49.1 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.60% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.32% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.12% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.00% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.98% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.18% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.70% | 94.45% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.07% | 93.04% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.58% | 100.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.30% | 83.82% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.93% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.38% | 91.19% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.22% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Agathis macrophylla |
Illicium angustisepalum |
Podocarpus fasciculus |
PubChem | 10591519 |
LOTUS | LTS0224698 |
wikiData | Q105115380 |