[(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxan-2-yl]methoxy]oxolan-3-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | c32802fd-7810-4a3f-97ab-273dfa5e5503 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxan-2-yl]methoxy]oxolan-3-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1C(C(C(O1)OCC2C(C(C(C(O2)OCC3=CC=CC=C3)O)O)O)O)(COC(=O)C=CC4=CC(=C(C=C4)O)O)O |
SMILES (Isomeric) | C1[C@@]([C@H]([C@@H](O1)OC[C@@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)OCC3=CC=CC=C3)O)O)O)O)(COC(=O)/C=C/C4=CC(=C(C=C4)O)O)O |
InChI | InChI=1S/C27H32O13/c28-17-8-6-15(10-18(17)29)7-9-20(30)38-13-27(35)14-39-26(24(27)34)37-12-19-21(31)22(32)23(33)25(40-19)36-11-16-4-2-1-3-5-16/h1-10,19,21-26,28-29,31-35H,11-14H2/b9-7+/t19-,21+,22+,23-,24+,25-,26-,27-/m1/s1 |
InChI Key | UMWARQXKAJGQSG-BNBINOFXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H32O13 |
Molecular Weight | 564.50 g/mol |
Exact Mass | 564.18429107 g/mol |
Topological Polar Surface Area (TPSA) | 205.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
![2D Structure of [(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxan-2-yl]methoxy]oxolan-3-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate 2D Structure of [(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxan-2-yl]methoxy]oxolan-3-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/fbd0e2a0-8586-11ee-a276-87346ca13d29.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.85% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.69% | 86.33% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 95.02% | 94.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.49% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.43% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.76% | 90.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.82% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.80% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.40% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 89.37% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.19% | 95.50% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 88.37% | 85.31% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.90% | 99.17% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 87.63% | 94.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.50% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.09% | 96.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.08% | 91.71% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 84.65% | 88.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.13% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.80% | 99.15% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.47% | 83.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.40% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Baccharis dracunculifolia |
PubChem | 163074708 |
LOTUS | LTS0222552 |
wikiData | Q105275786 |