(2R)-2-[(1S)-1-hydroxy-1-[(4S,5S,9S,10R,13S,17S)-4,5,17-trihydroxy-10,13-dimethyl-1-oxo-4,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one
Internal ID | ff0980df-780a-4b0e-ba04-28243576c486 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | (2R)-2-[(1S)-1-hydroxy-1-[(4S,5S,9S,10R,13S,17S)-4,5,17-trihydroxy-10,13-dimethyl-1-oxo-4,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2(CCC3=C4CCC5(C(C=CC(=O)C5(C4CCC32C)C)O)O)O)O)C |
SMILES (Isomeric) | CC1=C(C(=O)O[C@H](C1)[C@@](C)([C@@]2(CCC3=C4CC[C@]5([C@H](C=CC(=O)[C@@]5([C@H]4CC[C@@]32C)C)O)O)O)O)C |
InChI | InChI=1S/C28H38O7/c1-15-14-22(35-23(31)16(15)2)26(5,32)28(34)13-10-18-17-8-12-27(33)21(30)7-6-20(29)25(27,4)19(17)9-11-24(18,28)3/h6-7,19,21-22,30,32-34H,8-14H2,1-5H3/t19-,21-,22+,24-,25-,26-,27+,28-/m0/s1 |
InChI Key | HEDJQUGJAAFDJP-DRABWAQDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H38O7 |
Molecular Weight | 486.60 g/mol |
Exact Mass | 486.26175355 g/mol |
Topological Polar Surface Area (TPSA) | 124.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of (2R)-2-[(1S)-1-hydroxy-1-[(4S,5S,9S,10R,13S,17S)-4,5,17-trihydroxy-10,13-dimethyl-1-oxo-4,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one 2D Structure of (2R)-2-[(1S)-1-hydroxy-1-[(4S,5S,9S,10R,13S,17S)-4,5,17-trihydroxy-10,13-dimethyl-1-oxo-4,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/fb9e92e0-86d1-11ee-815d-b1db16523381.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL204 | P00734 | Thrombin | 95.59% | 96.01% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.38% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.76% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.01% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 90.57% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.05% | 97.14% |
CHEMBL1871 | P10275 | Androgen Receptor | 89.96% | 96.43% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.95% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.23% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.77% | 100.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.70% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.56% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.67% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.79% | 93.04% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.67% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.69% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.69% | 96.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.54% | 93.03% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.49% | 85.11% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.42% | 93.56% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.35% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.14% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis viscosa |
PubChem | 163195107 |
LOTUS | LTS0155355 |
wikiData | Q105026763 |