6,7-dimethoxy-7'-prop-1-en-2-ylspiro[2H-chromene-3,2'-7,8-dihydrofuro[2,3-g][1]benzofuran]-3',4-dione
| Internal ID | 3cc71b3b-bf27-4755-80ba-a2e527d25f2d |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | 6,7-dimethoxy-7'-prop-1-en-2-ylspiro[2H-chromene-3,2'-7,8-dihydrofuro[2,3-g][1]benzofuran]-3',4-dione |
| SMILES (Canonical) | CC(=C)C1CC2=C(O1)C=CC3=C2OC4(C3=O)COC5=CC(=C(C=C5C4=O)OC)OC |
| SMILES (Isomeric) | CC(=C)C1CC2=C(O1)C=CC3=C2OC4(C3=O)COC5=CC(=C(C=C5C4=O)OC)OC |
| InChI | InChI=1S/C23H20O7/c1-11(2)16-7-13-15(29-16)6-5-12-20(13)30-23(21(12)24)10-28-17-9-19(27-4)18(26-3)8-14(17)22(23)25/h5-6,8-9,16H,1,7,10H2,2-4H3 |
| InChI Key | KHTBJSIQGJZWIL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.12090297 g/mol |
| Topological Polar Surface Area (TPSA) | 80.30 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
![2D Structure of 6,7-dimethoxy-7'-prop-1-en-2-ylspiro[2H-chromene-3,2'-7,8-dihydrofuro[2,3-g][1]benzofuran]-3',4-dione](https://plantaedb.com/storage/docs/compounds/2023/11/fb71e550-8605-11ee-bac1-1b6c9c93c4cb.jpg "2D Structure of 6,7-dimethoxy-7'-prop-1-en-2-ylspiro[2H-chromene-3,2'-7,8-dihydrofuro[2,3-g][1]benzofuran]-3',4-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.80% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.06% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.47% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.57% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.12% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.51% | 85.14% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.93% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.72% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.90% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.64% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.60% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.34% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.01% | 90.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.13% | 96.77% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.07% | 97.09% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.92% | 94.80% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.30% | 94.00% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.04% | 82.67% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.96% | 91.19% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.44% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.14% | 94.45% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.93% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tephrosia candida |
| PubChem | 162942360 |
| LOTUS | LTS0083972 |
| wikiData | Q104170297 |