Fatsicarpain G
Internal ID | 0e2db2c6-93c4-4c5b-b482-c8d7a87dd314 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,4S,5R,8R,9R,10R,13S,14R,17S,18R)-10-hydroxy-9-(hydroxymethyl)-4,5,9,13,20,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-23-one |
SMILES (Canonical) | CC1(CCC23CCC4(C5(CCC6C(C5C=CC4(C2C1)OC3=O)(CCC(C6(C)CO)O)C)C)C)C |
SMILES (Isomeric) | C[C@]12CC[C@H]([C@@]([C@@H]1CC[C@@]3([C@@H]2C=C[C@@]45[C@]3(CC[C@@]6([C@H]4CC(CC6)(C)C)C(=O)O5)C)C)(C)CO)O |
InChI | InChI=1S/C30H46O4/c1-24(2)13-15-29-16-14-28(6)27(5)11-7-19-25(3,10-9-22(32)26(19,4)18-31)20(27)8-12-30(28,21(29)17-24)34-23(29)33/h8,12,19-22,31-32H,7,9-11,13-18H2,1-6H3/t19-,20-,21-,22-,25+,26+,27-,28+,29+,30+/m1/s1 |
InChI Key | CEBUWXCYJVYZSN-XEMCBIIJSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H46O4 |
Molecular Weight | 470.70 g/mol |
Exact Mass | 470.33960994 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 6.40 |
CHEBI:69222 |
CHEMBL1823030 |
DTXSID401166988 |
Q27137561 |
rel-(3alpha)-3,23-Dihydroxy-13,28-epoxyolean-11-en-28-one |
Olean-11-en-28-oic acid, 3,13,23-trihydroxy-, gamma-lactone, (3alpha,4alpha)- |
1318005-71-8 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.70% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.91% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.18% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.83% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.72% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.14% | 96.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.51% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.30% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.50% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.61% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.93% | 95.56% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.96% | 96.43% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.16% | 95.93% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.09% | 90.17% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 82.53% | 94.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.09% | 97.25% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.64% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fatsia polycarpa |
PubChem | 53493585 |
LOTUS | LTS0185352 |
wikiData | Q27137561 |