fatsicarpain C
Internal ID | 1c7c8fd2-59f3-437e-820b-827d329d1521 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4aS,6aR,6aS,6bR,8aR,9S,10R,12aS)-9-formyl-10-hydroxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=C2C1)C=CC4C3(CCC5C4(CCC(C5(C)C=O)O)C)C)C)C(=O)O)C |
SMILES (Isomeric) | C[C@]12CC[C@H]([C@@]([C@@H]1CC[C@@]3([C@@H]2C=CC4=C5CC(CC[C@@]5(CC[C@]43C)C(=O)O)(C)C)C)(C)C=O)O |
InChI | InChI=1S/C30H44O4/c1-25(2)13-15-30(24(33)34)16-14-28(5)19(20(30)17-25)7-8-22-26(3)11-10-23(32)27(4,18-31)21(26)9-12-29(22,28)6/h7-8,18,21-23,32H,9-17H2,1-6H3,(H,33,34)/t21-,22-,23-,26+,27+,28-,29-,30+/m1/s1 |
InChI Key | BICZFYRWUHELRT-KFYXPMKRSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H44O4 |
Molecular Weight | 468.70 g/mol |
Exact Mass | 468.32395988 g/mol |
Topological Polar Surface Area (TPSA) | 74.60 Ų |
XlogP | 6.20 |
CHEBI:69218 |
CHEMBL1823026 |
DTXSID901196550 |
Q27137557 |
23-formyl-3alpha-hydroxyolean-11,13(18)-dien-28-oic acid |
(3alpha)-3-hydroxy-23-oxooleana-11,13(18)-dien-28-oic acid |
(3alpha,4alpha)-3-Hydroxy-23-oxooleana-11,13(18)-dien-28-oic acid |
1318005-61-6 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.31% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.24% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.10% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.19% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.50% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.69% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 87.92% | 98.95% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.78% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.26% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 83.08% | 97.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.09% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fatsia polycarpa |
PubChem | 53493448 |
LOTUS | LTS0021902 |
wikiData | Q27137557 |