Farneside A
| Internal ID | af695962-ae66-4915-82df-41109d153e0e |
| Taxonomy | Nucleosides, nucleotides, and analogues > Pyrimidine nucleosides |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(E)-3-methyl-5-[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]pent-2-enoxy]methyl]oxolan-2-yl]-1,3-diazinane-2,4-dione |
| SMILES (Canonical) | CC(=CCCC1(C(O1)CCC(=CCOCC2C(C(C(O2)N3CCC(=O)NC3=O)O)O)C)C)C |
| SMILES (Isomeric) | CC(=CCCC1(C(O1)CC/C(=C/COC[C@@H]2[C@H]([C@H]([C@@H](O2)N3CCC(=O)NC3=O)O)O)/C)C)C |
| InChI | InChI=1S/C24H38N2O7/c1-15(2)6-5-11-24(4)18(33-24)8-7-16(3)10-13-31-14-17-20(28)21(29)22(32-17)26-12-9-19(27)25-23(26)30/h6,10,17-18,20-22,28-29H,5,7-9,11-14H2,1-4H3,(H,25,27,30)/b16-10+/t17-,18?,20-,21-,22-,24?/m1/s1 |
| InChI Key | PMYKSEMADATAMV-AOUILNQWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H38N2O7 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.26790156 g/mol |
| Topological Polar Surface Area (TPSA) | 121.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.55% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.47% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.27% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.83% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.35% | 97.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.17% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.43% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.52% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.14% | 90.08% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.94% | 94.73% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 86.83% | 97.78% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.67% | 98.59% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.80% | 95.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 85.23% | 95.93% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.65% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.93% | 89.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.78% | 93.10% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.73% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.09% | 90.17% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.03% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139583103 |
| LOTUS | LTS0085966 |
| wikiData | Q75052820 |