4-hydroxy-9-[(4-hydroxy-6,10-dimethyl-2-oxo-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-3-yl)methyl]-6,10-dimethyl-3-methylidene-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-2-one
| Internal ID | b0bc0ac4-5a70-4dd6-aa3d-d527ad087dc3 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
| IUPAC Name | 4-hydroxy-9-[(4-hydroxy-6,10-dimethyl-2-oxo-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-3-yl)methyl]-6,10-dimethyl-3-methylidene-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| SMILES (Canonical) | CC1=CC(C2C(CC(=CCC1)C)OC(=O)C2CC3CCC(=CC(C4C(C=C3C)OC(=O)C4=C)O)C)O |
| SMILES (Isomeric) | CC1=CC(C2C(CC(=CCC1)C)OC(=O)C2CC3CCC(=CC(C4C(C=C3C)OC(=O)C4=C)O)C)O |
| InChI | InChI=1S/C30H40O6/c1-16-7-6-8-17(2)13-25-28(24(32)11-16)22(30(34)36-25)15-21-10-9-18(3)12-23(31)27-20(5)29(33)35-26(27)14-19(21)4/h8,11-12,14,21-28,31-32H,5-7,9-10,13,15H2,1-4H3 |
| InChI Key | LBGWJDAAVFZTFT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.28248899 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of 4-hydroxy-9-[(4-hydroxy-6,10-dimethyl-2-oxo-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-3-yl)methyl]-6,10-dimethyl-3-methylidene-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/faf5e260-8423-11ee-b0b7-fbfb091e8d5a.jpg "2D Structure of 4-hydroxy-9-[(4-hydroxy-6,10-dimethyl-2-oxo-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-3-yl)methyl]-6,10-dimethyl-3-methylidene-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.18% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.39% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.29% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.80% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.03% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.84% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.64% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.80% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.64% | 99.23% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.10% | 94.80% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.77% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mikania pohlii |
| PubChem | 162922106 |
| LOTUS | LTS0210631 |
| wikiData | Q105149256 |