(1S,9R,12R,16R)-6-ethyl-13,14,15-trihydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione
| Internal ID | 87f445c3-b74a-4aa2-a9be-f5fd77eaaa16 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
| IUPAC Name | (1S,9R,12R,16R)-6-ethyl-13,14,15-trihydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione |
| SMILES (Canonical) | CCC1=C2CC3C4C(C2=CC(=O)O1)(C(C(C(C4(C(=O)O3)C)O)O)O)C |
| SMILES (Isomeric) | CCC1=C2C[C@@H]3[C@@H]4[C@@](C2=CC(=O)O1)(C(C(C([C@@]4(C(=O)O3)C)O)O)O)C |
| InChI | InChI=1S/C18H22O7/c1-4-9-7-5-10-13-17(2,8(7)6-11(19)24-9)14(21)12(20)15(22)18(13,3)16(23)25-10/h6,10,12-15,20-22H,4-5H2,1-3H3/t10-,12?,13-,14?,15?,17-,18-/m1/s1 |
| InChI Key | BBNIEZUCHOPINF-ZWYIPDRBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.13655304 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | -0.40 |
| There are no found synonyms. |
![2D Structure of (1S,9R,12R,16R)-6-ethyl-13,14,15-trihydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione](https://plantaedb.com/storage/docs/compounds/2023/11/faecc4d0-8534-11ee-8234-eb855cc11afa.jpg "2D Structure of (1S,9R,12R,16R)-6-ethyl-13,14,15-trihydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.47% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.12% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.82% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.92% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.74% | 97.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.51% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.17% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.38% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.77% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.27% | 92.62% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.66% | 93.65% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.76% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.50% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.77% | 90.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.24% | 97.09% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.03% | 96.37% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nageia nagi |
| PubChem | 162818720 |
| LOTUS | LTS0236154 |
| wikiData | Q104922882 |