(1S,12S,20S)-20-methoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol
Internal ID | 171bf381-9927-4ec8-8f49-a5033537c974 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
IUPAC Name | (1S,12S,20S)-20-methoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol |
SMILES (Canonical) | COC1C2C(C3=C(O1)C=C(C=C3)O)OC4=CC5=C(C=C24)OCO5 |
SMILES (Isomeric) | CO[C@@H]1[C@@H]2[C@@H](C3=C(O1)C=C(C=C3)O)OC4=CC5=C(C=C24)OCO5 |
InChI | InChI=1S/C17H14O6/c1-19-17-15-10-5-13-14(21-7-20-13)6-12(10)22-16(15)9-3-2-8(18)4-11(9)23-17/h2-6,15-18H,7H2,1H3/t15-,16+,17-/m0/s1 |
InChI Key | BARRXUGKUYTIQH-BBWFWOEESA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H14O6 |
Molecular Weight | 314.29 g/mol |
Exact Mass | 314.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 66.40 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of (1S,12S,20S)-20-methoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol 2D Structure of (1S,12S,20S)-20-methoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol](https://plantaedb.com/storage/docs/compounds/2023/11/f98c10e0-83d2-11ee-bf57-df184d8a7877.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.47% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.37% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.25% | 86.33% |
CHEMBL240 | Q12809 | HERG | 90.04% | 89.76% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.96% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.31% | 94.80% |
CHEMBL2581 | P07339 | Cathepsin D | 88.25% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.85% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.59% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.98% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.15% | 89.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.02% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.57% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.45% | 94.73% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.30% | 95.89% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 81.05% | 95.55% |
CHEMBL2535 | P11166 | Glucose transporter | 80.57% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sophora fraseri |
Sophora koreensis |
Sophora tomentosa |
PubChem | 163086781 |
LOTUS | LTS0275593 |
wikiData | Q104922375 |