8-(4-Carboxy-3-methylbutyl)-4-formyl-7,8-dimethyl-1,2,5,6,7,8a-hexahydronaphthalene-4a-carboxylic acid
Internal ID | 1c064f31-bb92-41cd-881f-48eb24a7b03e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
IUPAC Name | 8-(4-carboxy-3-methylbutyl)-4-formyl-7,8-dimethyl-1,2,5,6,7,8a-hexahydronaphthalene-4a-carboxylic acid |
SMILES (Canonical) | CC1CCC2(C(C1(C)CCC(C)CC(=O)O)CCC=C2C=O)C(=O)O |
SMILES (Isomeric) | CC1CCC2(C(C1(C)CCC(C)CC(=O)O)CCC=C2C=O)C(=O)O |
InChI | InChI=1S/C20H30O5/c1-13(11-17(22)23)7-9-19(3)14(2)8-10-20(18(24)25)15(12-21)5-4-6-16(19)20/h5,12-14,16H,4,6-11H2,1-3H3,(H,22,23)(H,24,25) |
InChI Key | VDSOVKJAGXHVPE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O5 |
Molecular Weight | 350.40 g/mol |
Exact Mass | 350.20932405 g/mol |
Topological Polar Surface Area (TPSA) | 91.70 Ų |
XlogP | 3.90 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.68% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.22% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 93.40% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.23% | 90.17% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.11% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.15% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.36% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.38% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.04% | 93.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.59% | 90.71% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.87% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.86% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.74% | 97.09% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.68% | 94.08% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.63% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Olearia teretifolia |
PubChem | 162919023 |
LOTUS | LTS0181071 |
wikiData | Q105284359 |