[7,19-Dihydroxy-6-(2-hydroxyethyl)-11,17-dimethyl-3,9,15,21-tetraoxo-22-oxa-6-azaheptacyclo[12.9.1.11,16.14,8.02,13.012,26.020,25]hexacosa-2(13),4,7,10,12(26),16(25),17,19-octaen-24-yl] acetate
| Internal ID | 312fe6a6-1d7a-457b-9a80-edaf7fe515cc |
| Taxonomy | Benzenoids > Dibenzocycloheptenes |
| IUPAC Name | [7,19-dihydroxy-6-(2-hydroxyethyl)-11,17-dimethyl-3,9,15,21-tetraoxo-22-oxa-6-azaheptacyclo[12.9.1.11,16.14,8.02,13.012,26.020,25]hexacosa-2(13),4,7,10,12(26),16(25),17,19-octaen-24-yl] acetate |
| SMILES (Canonical) | CC1=CC(=C2C3=C1C(=O)C4C(C3(COC2=O)C5=C4C6=C7C(=CN(C(=C7C(=O)C=C6C)O)CCO)C5=O)OC(=O)C)O |
| SMILES (Isomeric) | CC1=CC(=C2C3=C1C(=O)C4C(C3(COC2=O)C5=C4C6=C7C(=CN(C(=C7C(=O)C=C6C)O)CCO)C5=O)OC(=O)C)O |
| InChI | InChI=1S/C30H23NO10/c1-10-6-14(34)19-18-13(8-31(4-5-32)28(19)38)25(36)24-21(16(10)18)22-26(37)17-11(2)7-15(35)20-23(17)30(24,9-40-29(20)39)27(22)41-12(3)33/h6-8,22,27,32,35,38H,4-5,9H2,1-3H3 |
| InChI Key | WAHOUCCFIHSJQV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H23NO10 |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.13219593 g/mol |
| Topological Polar Surface Area (TPSA) | 168.00 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.26% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.68% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.74% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.50% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.42% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.91% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.88% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.45% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.90% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.76% | 83.82% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.19% | 99.15% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.96% | 85.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.96% | 95.89% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.83% | 93.65% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.75% | 94.75% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.64% | 91.07% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.93% | 92.62% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.37% | 93.40% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.33% | 91.19% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.31% | 94.73% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.63% | 96.77% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.02% | 97.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.50% | 90.08% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.43% | 97.25% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.09% | 88.56% |
| CHEMBL5028 | O14672 | ADAM10 | 80.05% | 97.50% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.01% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139587409 |
| LOTUS | LTS0088277 |
| wikiData | Q77565346 |