[1-[[4,5-Dihydroxy-6-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-4-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl]oxy]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl] 2-hydroxy-3-methylbutanoate
Internal ID | 688a30d1-61fa-4675-bd1a-b8bc4aa7db77 |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Glycodepsipeptides |
IUPAC Name | [1-[[4,5-dihydroxy-6-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-4-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl]oxy]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl] 2-hydroxy-3-methylbutanoate |
SMILES (Canonical) | CC(C)C(C(=O)OC(CC1=CC=C(C=C1)O)C(=O)OC2CCC(C3C2(CCC(C3O)C(=C)C(=O)OC)C)(COC4C(C(C(C(O4)CO)O)O)O)O)O |
SMILES (Isomeric) | CC(C)C(C(=O)OC(CC1=CC=C(C=C1)O)C(=O)OC2CCC(C3C2(CCC(C3O)C(=C)C(=O)OC)C)(COC4C(C(C(C(O4)CO)O)O)O)O)O |
InChI | InChI=1S/C36H52O16/c1-17(2)25(39)33(46)50-22(14-19-6-8-20(38)9-7-19)32(45)52-24-11-13-36(47,16-49-34-29(43)28(42)27(41)23(15-37)51-34)30-26(40)21(10-12-35(24,30)4)18(3)31(44)48-5/h6-9,17,21-30,34,37-43,47H,3,10-16H2,1-2,4-5H3 |
InChI Key | IXOSXWZLCNJRLS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H52O16 |
Molecular Weight | 740.80 g/mol |
Exact Mass | 740.32553557 g/mol |
Topological Polar Surface Area (TPSA) | 259.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.09% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.11% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.82% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 97.60% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.60% | 94.45% |
CHEMBL4072 | P07858 | Cathepsin B | 92.53% | 93.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.77% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.99% | 95.89% |
CHEMBL268 | P43235 | Cathepsin K | 89.47% | 96.85% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.61% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.21% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.13% | 97.09% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.67% | 95.83% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.31% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.16% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.03% | 97.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.13% | 92.62% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.33% | 91.24% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.23% | 100.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.22% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.19% | 82.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.16% | 96.00% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.14% | 85.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.47% | 94.33% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.03% | 94.97% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ixeris repens |
PubChem | 14733700 |
LOTUS | LTS0118154 |
wikiData | Q105122353 |