2-(3,4-dihydroxyphenyl)-4-[[2-(3,4-dihydroxyphenyl)-3,7,8-trihydroxy-3,4-dihydro-2H-chromen-4-yl]oxy]-3,4-dihydro-2H-chromene-3,7,8-triol
Internal ID | 8a63045a-909a-4c8e-ae05-8c23017bb7c3 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Leucoanthocyanidins |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-4-[[2-(3,4-dihydroxyphenyl)-3,7,8-trihydroxy-3,4-dihydro-2H-chromen-4-yl]oxy]-3,4-dihydro-2H-chromene-3,7,8-triol |
SMILES (Canonical) | C1=CC(=C(C=C1C2C(C(C3=C(O2)C(=C(C=C3)O)O)OC4C(C(OC5=C4C=CC(=C5O)O)C6=CC(=C(C=C6)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2C(C(C3=C(O2)C(=C(C=C3)O)O)OC4C(C(OC5=C4C=CC(=C5O)O)C6=CC(=C(C=C6)O)O)O)O)O)O |
InChI | InChI=1S/C30H26O13/c31-15-5-1-11(9-19(15)35)25-23(39)29(13-3-7-17(33)21(37)27(13)41-25)43-30-14-4-8-18(34)22(38)28(14)42-26(24(30)40)12-2-6-16(32)20(36)10-12/h1-10,23-26,29-40H |
InChI Key | KBCIHRRYAIBEDE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H26O13 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.13734088 g/mol |
Topological Polar Surface Area (TPSA) | 230.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.34% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.25% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.51% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.80% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.62% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.70% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.33% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 84.44% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.55% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.47% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 81.48% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.04% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acacia melanoxylon |
PubChem | 14463819 |
LOTUS | LTS0227103 |
wikiData | Q105138104 |