[(1S,2R,3R,4R,5S,6S,8R,9R,10R,13S,16S,17R,18R)-8-acetyloxy-11-ethyl-5-hydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadec-14-en-4-yl] 4-methoxybenzoate
Internal ID | 98dee2ba-3098-4245-8ed5-a46aa76b860d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
IUPAC Name | [(1S,2R,3R,4R,5S,6S,8R,9R,10R,13S,16S,17R,18R)-8-acetyloxy-11-ethyl-5-hydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadec-14-en-4-yl] 4-methoxybenzoate |
SMILES (Canonical) | CCN1CC2(C=CC(C34C2C(C(C31)C5(CC(C6(CC4C5C6OC(=O)C7=CC=C(C=C7)OC)O)OC)OC(=O)C)OC)OC)COC |
SMILES (Isomeric) | CCN1C[C@@]2(C=C[C@@H]([C@@]34[C@@H]2[C@H]([C@@H]([C@H]31)[C@]5(C[C@@H]([C@]6(C[C@@H]4[C@@H]5[C@H]6OC(=O)C7=CC=C(C=C7)OC)O)OC)OC(=O)C)OC)OC)COC |
InChI | InChI=1S/C35H47NO10/c1-8-36-17-32(18-40-3)14-13-23(42-5)35-22-15-33(39)24(43-6)16-34(46-19(2)37,26(29(35)36)27(44-7)28(32)35)25(22)30(33)45-31(38)20-9-11-21(41-4)12-10-20/h9-14,22-30,39H,8,15-18H2,1-7H3/t22-,23+,24+,25-,26+,27+,28-,29-,30-,32+,33+,34-,35+/m1/s1 |
InChI Key | LMEGTVYLQDXSHB-IBOHHWAHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H47NO10 |
Molecular Weight | 641.70 g/mol |
Exact Mass | 641.31999670 g/mol |
Topological Polar Surface Area (TPSA) | 122.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of [(1S,2R,3R,4R,5S,6S,8R,9R,10R,13S,16S,17R,18R)-8-acetyloxy-11-ethyl-5-hydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadec-14-en-4-yl] 4-methoxybenzoate 2D Structure of [(1S,2R,3R,4R,5S,6S,8R,9R,10R,13S,16S,17R,18R)-8-acetyloxy-11-ethyl-5-hydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadec-14-en-4-yl] 4-methoxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/f7b4aa50-85e8-11ee-b5df-491d528206ca.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.66% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.24% | 90.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.20% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.52% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 94.19% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.07% | 98.95% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 91.20% | 81.11% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.57% | 91.11% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.27% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.25% | 95.89% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 88.40% | 87.67% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.29% | 96.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 87.28% | 94.08% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.89% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.16% | 94.00% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 85.29% | 94.97% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.75% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.37% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.83% | 93.99% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.31% | 93.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.60% | 92.94% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 80.56% | 96.47% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.29% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aconitum episcopale |
PubChem | 100987531 |
LOTUS | LTS0108370 |
wikiData | Q105153912 |