[(2S,3S,4R,5R)-2-[(2R,3R,4S,5R,6R)-4-[(2S,3R,4S,5R,6R)-6-(acetyloxymethyl)-3,5-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]-5-(hydroxymethyl)oxolan-3-yl] benzoate
Internal ID | 2a8d5fbe-1bd5-48f9-a6a9-2ed76e24d109 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3S,4R,5R)-2-[(2R,3R,4S,5R,6R)-4-[(2S,3R,4S,5R,6R)-6-(acetyloxymethyl)-3,5-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]-5-(hydroxymethyl)oxolan-3-yl] benzoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)OC4(C(C(C(O4)CO)O)OC(=O)C5=CC=CC=C5)COC(=O)C=CC6=CC(=C(C=C6)O)OC)COC(=O)C=CC7=CC(=C(C=C7)O)OC)O)O)OC8C(C(C(C(O8)CO)O)O)O)O |
SMILES (Isomeric) | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]([C@H](O[C@@H]([C@@H]2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O[C@]4([C@H]([C@@H]([C@H](O4)CO)O)OC(=O)C5=CC=CC=C5)COC(=O)/C=C/C6=CC(=C(C=C6)O)OC)COC(=O)/C=C/C7=CC(=C(C=C7)O)OC)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O |
InChI | InChI=1S/C59H74O34/c1-25(63)81-22-36-42(70)50(88-55-47(75)45(73)40(68)33(19-60)84-55)49(77)57(86-36)89-51-43(71)37(23-82-38(66)15-11-26-9-13-29(64)31(17-26)79-2)87-58(52(51)90-56-48(76)46(74)41(69)34(20-61)85-56)93-59(24-83-39(67)16-12-27-10-14-30(65)32(18-27)80-3)53(44(72)35(21-62)92-59)91-54(78)28-7-5-4-6-8-28/h4-18,33-37,40-53,55-58,60-62,64-65,68-77H,19-24H2,1-3H3/b15-11+,16-12+/t33-,34-,35-,36-,37-,40-,41-,42-,43-,44-,45+,46+,47-,48-,49-,50+,51+,52-,53+,55+,56+,57+,58-,59+/m1/s1 |
InChI Key | KCGWRMZNGGOXKP-DVNJQKDJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H74O34 |
Molecular Weight | 1327.20 g/mol |
Exact Mass | 1326.4061494 g/mol |
Topological Polar Surface Area (TPSA) | 510.00 Ų |
XlogP | -3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 99.45% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.22% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 98.12% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.90% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.18% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.61% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.42% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.53% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 88.16% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 87.55% | 90.71% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.76% | 83.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.32% | 91.19% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.30% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.06% | 95.50% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 84.73% | 98.21% |
CHEMBL5028 | O14672 | ADAM10 | 84.70% | 97.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.31% | 90.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.71% | 90.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.15% | 97.14% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.61% | 94.08% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.81% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygala fallax |
PubChem | 101707482 |
LOTUS | LTS0095500 |
wikiData | Q105138732 |